Your company account is blocked and you cannot place orders. If you have questions, please contact your company administrator.

US9247759, 12-10

ID: ALA3891080

PubChem CID: 53375056

Max Phase: Preclinical

Molecular Formula: C21H23N5O5

Molecular Weight: 425.45

Molecule Type: Small molecule

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1noc(C)c1Cn1cc(N2C(=O)N(Cc3cccc(O)c3)C(C)(CO)C2=O)cn1

Standard InChI:  InChI=1S/C21H23N5O5/c1-13-18(14(2)31-23-13)11-24-10-16(8-22-24)26-19(29)21(3,12-27)25(20(26)30)9-15-5-4-6-17(28)7-15/h4-8,10,27-28H,9,11-12H2,1-3H3

Standard InChI Key:  ZSXFQZVWZLKEEP-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   -0.1994  -10.8929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3780  -11.1183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0241  -12.4721    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5112  -12.2759    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7842  -10.8010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8641  -10.2777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4687  -10.1072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2695   -8.6197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8843   -8.0486    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5287   -6.5913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9508   -6.4988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5359   -7.8671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3917   -8.8371    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8372   -5.2877    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3786   -3.8595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2409   -3.4780    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3383   -1.3500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8056   -3.8679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0341   -2.6899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8982   -4.8779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6521   -6.0524    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3372   -5.2929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0391   -6.2662    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  5  7  1  0
  7  2  2  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  9  1  0
 11 14  1  0
 14 15  1  0
 15 16  2  0
 15 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  1  0
 23 25  2  0
 25 19  1  0
 17 26  1  0
 26 27  1  0
 26 28  1  0
 28 29  1  0
 26 30  1  0
 30 14  1  0
 30 31  2  0
M  END

Associated Targets(Human)

TAS2R8 Tchem Taste receptor type 2 member 8 (387 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Calculated Properties

Molecular Weight: 425.45Molecular Weight (Monoisotopic): 425.1699AlogP: 1.96#Rotatable Bonds: 6
Polar Surface Area: 124.93Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.41CX Basic pKa: 1.67CX LogP: 0.88CX LogD: 0.87
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.58Np Likeness Score: -1.11

References

1.  (2016)  Identification of human T2R receptors that respond to bitter compounds that elicit the bitter taste in compositions, and the use thereof in assays to identify compounds that inhibit (block) bitter taste in compositions and use thereof, 
2. Fotsing JR, Darmohusodo V, Patron AP, Ching BW, Brady T, Arellano M, Chen Q, Davis TJ, Liu H, Servant G, Zhang L, Williams M, Saganich M, Ditschun T, Tachdjian C, Karanewsky DS..  (2020)  Discovery and Development of S6821 and S7958 as Potent TAS2R8 Antagonists.,  63  (9): [PMID:32330040] [10.1021/acs.jmedchem.0c00388]