US9475795, 80

ID: ALA3891242

PubChem CID: 72550891

Max Phase: Preclinical

Molecular Formula: C17H20ClF2N3O2S

Molecular Weight: 403.88

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1n[nH]c(C)c1S(=O)(=O)N1CCC(F)(Cc2ccc(Cl)cc2F)CC1

Standard InChI:  InChI=1S/C17H20ClF2N3O2S/c1-11-16(12(2)22-21-11)26(24,25)23-7-5-17(20,6-8-23)10-13-3-4-14(18)9-15(13)19/h3-4,9H,5-8,10H2,1-2H3,(H,21,22)

Standard InChI Key:  RXIULEDXXPGKEE-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 26 28  0  0  0  0  0  0  0  0999 V2000
    3.1417    1.5281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0377    0.7299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5052    1.0408    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2543   -0.2587    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2499   -1.3728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4917   -2.5482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8990   -0.7508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5988   -1.5004    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.5984   -2.7004    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6377   -2.1009    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2696    1.9496    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5625   -0.0216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5631   -1.5224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2495   -2.2473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2215   -3.7471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5064   -4.5211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4841   -5.7209    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -3.8192   -3.7954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8471   -2.2957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8973   -1.7150    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  5  7  2  0
  7  2  1  0
  7  8  1  0
  8  9  2  0
  8 10  2  0
  8 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 20 22  1  0
 22 23  2  0
 23 17  1  0
 23 24  1  0
 14 25  1  0
 25 26  1  0
 26 11  1  0
M  END

Associated Targets(Human)

PROKR1 Tchem Prokineticin receptor 1 (175 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 403.88Molecular Weight (Monoisotopic): 403.0933AlogP: 3.55#Rotatable Bonds: 4
Polar Surface Area: 66.06Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 10.99CX Basic pKa: 2.62CX LogP: 2.55CX LogD: 2.55
Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.85Np Likeness Score: -1.90

References

1.  (2016)  Sulfonyl piperidine derivatives and their use for treating prokineticin mediated diseases, 

Source

Source(1):