The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((3S,3aR,6R,6aS)-6-(benzyloxy)hexahydrofuro[3,2-b]furan-3-yl)-N-(1-(cyclohexylamino)-2-methyl-1-oxopropan-2-yl)benzamide ID: ALA3891631
PubChem CID: 134137014
Max Phase: Preclinical
Molecular Formula: C30H38N2O5
Molecular Weight: 506.64
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C(=O)NC1CCCCC1)N(C(=O)c1ccccc1)[C@H]1CO[C@H]2[C@@H]1OC[C@H]2OCc1ccccc1
Standard InChI: InChI=1S/C30H38N2O5/c1-30(2,29(34)31-23-16-10-5-11-17-23)32(28(33)22-14-8-4-9-15-22)24-19-36-27-25(20-37-26(24)27)35-18-21-12-6-3-7-13-21/h3-4,6-9,12-15,23-27H,5,10-11,16-20H2,1-2H3,(H,31,34)/t24-,25+,26+,27+/m0/s1
Standard InChI Key: BWSWAUHPWHRBDT-FICKONGGSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
9.6491 -7.3118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4366 -8.1117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2356 -7.8958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7556 -7.4052 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6884 -6.0708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2404 -6.7625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4871 -6.2872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5264 -7.1113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3223 -7.3287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7749 -6.6388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2587 -5.9953 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5201 -7.9325 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
7.4826 -5.4620 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
8.6144 -8.0998 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0921 -8.7388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8391 -8.8357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3841 -9.5103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2780 -8.6059 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8598 -10.1448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1511 -10.9157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9660 -11.0492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4888 -10.4056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1947 -9.6372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6639 -8.8502 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4142 -9.5428 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0638 -9.5717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6355 -10.2756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0319 -10.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8570 -11.0136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2841 -10.3068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8861 -9.5812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3935 -5.3001 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5686 -5.2960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1598 -4.5796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5791 -3.8689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1709 -3.1528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3450 -3.1483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9292 -3.8657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3399 -4.5787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 8 1 0
7 5 1 0
5 6 1 0
6 4 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 7 1 0
8 12 1 6
7 13 1 6
9 14 1 6
14 15 1 0
14 2 1 0
2 16 1 0
15 17 1 0
15 18 2 0
17 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 17 1 0
16 24 1 0
16 25 2 0
24 26 1 0
26 27 1 0
26 31 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
5 32 1 1
32 33 1 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 506.64Molecular Weight (Monoisotopic): 506.2781AlogP: 4.11#Rotatable Bonds: 8Polar Surface Area: 77.10Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.45CX LogD: 4.45Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.58Np Likeness Score: -0.23
References 1. Barros TG, Santos JAN, de Souza BEG, Sodero ACR, de Souza AMT, da Silva DP, Rodrigues CR, Pinheiro S, Dias LRS, Abrahim-Vieira B, Puzer L, Muri EMF.. (2017) Discovery of a new isomannide-based peptidomimetic synthetized by Ugi multicomponent reaction as human tissue kallikrein 1 inhibitor., 27 (2): [PMID:27914800 ] [10.1016/j.bmcl.2016.11.051 ]