1,16-bis(4-aminopyridinium)hexadecane dibromide

ID: ALA389170

PubChem CID: 44423473

Max Phase: Preclinical

Molecular Formula: C26H44Br2N4

Molecular Weight: 412.67

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Synonyms: 1,16-Bis(4-Aminopyridinium)Hexadecane Dibromide | CHEMBL389170|1,16-bis(4-aminopyridinium)hexadecane dibromide

Canonical SMILES:  Nc1cc[n+](CCCCCCCCCCCCCCCC[n+]2ccc(N)cc2)cc1.[Br-].[Br-]

Standard InChI:  InChI=1S/C26H42N4.2BrH/c27-25-15-21-29(22-16-25)19-13-11-9-7-5-3-1-2-4-6-8-10-12-14-20-30-23-17-26(28)18-24-30;;/h15-18,21-24,27-28H,1-14,19-20H2;2*1H

Standard InChI Key:  YXFLHRPLQAUYBN-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 31  0  0  0  0  0  0  0  0999 V2000
    5.4062    3.5313    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   -4.0764    0.9209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0776    0.0935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3628   -0.3194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6463    0.0940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6492    0.9245    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3646    1.3336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9363    1.3397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2203    0.9299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5073    1.3451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2087    0.9353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9216    1.3505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6376    0.9407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3505    1.3558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0665    0.9460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7794    1.3612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7924   -0.3184    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.4955    0.9514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2084    1.3666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9244    0.9568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6373    1.3720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3533    0.9622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0662    1.3774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7823    0.9676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4952    1.3828    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.2106    0.9709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9230    1.3854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9203    2.2112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1993    2.6209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4898    2.2040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6327    2.6274    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2812    3.5313    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
 15 16  1  0
  4  5  2  0
  3 17  1  0
  8  9  1  0
 16 18  1  0
 18 19  1  0
  9 10  1  0
 19 20  1  0
  5  6  1  0
 20 21  1  0
 10 11  1  0
 21 22  1  0
  3  4  1  0
 22 23  1  0
 11 12  1  0
 23 24  1  0
  6  7  2  0
 24 25  1  0
 12 13  1  0
 25 26  2  0
  7  2  1  0
 26 27  1  0
 13 14  1  0
 27 28  2  0
  2  3  2  0
 28 29  1  0
 14 15  1  0
 29 30  2  0
 30 25  1  0
  6  8  1  0
 28 31  1  0
M  CHG  4   1  -1   6   1  25   1  32  -1
M  END

Associated Targets(non-human)

Cryptococcus neoformans (21258 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Candida albicans (78123 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PLB1 Phospholipase B (44 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 412.67Molecular Weight (Monoisotopic): 412.3555AlogP: 5.59#Rotatable Bonds: 17
Polar Surface Area: 59.80Molecular Species: NEUTRALHBA: 2HBD: 2
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 0.38CX LogP: -2.29CX LogD: -2.29
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.26Np Likeness Score: 0.05

References

1. Ng CK, Singhal V, Widmer F, Wright LC, Sorrell TC, Jolliffe KA..  (2007)  Synthesis, antifungal and haemolytic activity of a series of bis(pyridinium)alkanes.,  15  (10): [PMID:17383187] [10.1016/j.bmc.2007.03.018]

Source