The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1,2-O-dimyristoyl-3-O-(beta-D-glucopyranosyl)-racglycerol ID: ALA389178
PubChem CID: 44422380
Max Phase: Preclinical
Molecular Formula: C37H70O10
Molecular Weight: 674.96
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCCCCCCC(=O)OCC(CO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)OC(=O)CCCCCCCCCCCCC
Standard InChI: InChI=1S/C37H70O10/c1-3-5-7-9-11-13-15-17-19-21-23-25-32(39)44-28-30(29-45-37-36(43)35(42)34(41)31(27-38)47-37)46-33(40)26-24-22-20-18-16-14-12-10-8-6-4-2/h30-31,34-38,41-43H,3-29H2,1-2H3/t30?,31-,34-,35+,36-,37-/m1/s1
Standard InChI Key: HRYMSKIIGYWEAN-NJQKNBRTSA-N
Molfile:
RDKit 2D
47 47 0 0 1 0 0 0 0 0999 V2000
-3.3500 -17.3625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3500 -18.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6380 -18.5958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9260 -18.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9260 -17.3625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6380 -16.9458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2103 -16.9521 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2121 -18.6010 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6380 -19.4208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.0639 -18.6010 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.0657 -16.9521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0681 -16.1271 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4970 -17.3667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2186 -16.9563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9319 -17.3709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2211 -16.1313 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9367 -15.7209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9392 -14.8959 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6476 -16.9605 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3657 -15.7251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0789 -16.1397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7946 -15.7293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5079 -16.1438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2236 -15.7334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9368 -16.1480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6500 -16.1355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3608 -17.3751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0765 -16.9647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3584 -18.2001 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7898 -17.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5055 -16.9688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2187 -17.3834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6477 -17.3876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9344 -16.9730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6525 -15.7376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3657 -16.1522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0766 -17.3918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3633 -16.9772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0814 -15.7418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7947 -16.1564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5055 -17.3960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2212 -16.9856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7923 -16.9814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5104 -15.7460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2236 -16.1606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9345 -17.4002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6501 -16.9898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22 23 1 0
4 5 1 0
23 24 1 0
11 12 1 0
24 25 1 0
5 6 1 0
7 13 1 0
19 27 1 0
27 28 1 0
13 14 1 0
27 29 2 0
5 7 1 1
28 30 1 0
14 15 1 0
30 31 1 0
1 2 1 0
31 32 1 0
32 34 1 0
14 16 1 0
34 33 1 0
33 38 1 0
15 19 1 0
4 8 1 6
25 35 1 0
35 36 1 0
16 17 1 0
1 6 1 0
38 37 1 0
37 43 1 0
17 18 2 0
17 26 1 0
36 39 1 0
3 9 1 1
39 40 1 0
2 3 1 0
43 41 1 0
26 20 1 0
41 42 1 0
2 10 1 6
20 21 1 0
40 44 1 0
44 45 1 0
3 4 1 0
21 22 1 0
42 46 1 0
1 11 1 1
46 47 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 674.96Molecular Weight (Monoisotopic): 674.4969AlogP: 6.66#Rotatable Bonds: 31Polar Surface Area: 151.98Molecular Species: NEUTRALHBA: 10HBD: 4#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.21CX Basic pKa: ┄CX LogP: 8.45CX LogD: 8.45Aromatic Rings: ┄Heavy Atoms: 47QED Weighted: 0.05Np Likeness Score: 0.96
References 1. Cateni F, Bonivento P, Procida G, Zacchigna M, Gabrielli Favretto L, Scialino G, Banfi E.. (2007) Chemoenzymatic synthesis and antimicrobial activity evaluation of monoglucosyl diglycerides., 15 (2): [PMID:17088068 ] [10.1016/j.bmc.2006.10.045 ] 2. Cateni F, Bonivento P, Procida G, Zacchigna M, Scialino G, Banfi E.. (2007) Chemoenzymatic synthesis and in vitro studies on the hydrolysis of antimicrobial monoglycosyl diglycerides by pancreatic lipase., 17 (7): [PMID:17270436 ] [10.1016/j.bmcl.2007.01.019 ]