The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9296747, Example 18 ID: ALA3892475
PubChem CID: 118983114
Max Phase: Preclinical
Molecular Formula: C18H22N4O5
Molecular Weight: 374.40
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)N1CCc2nc(Nc3cc(OC)c(OC)c(OC)c3)ncc2C1
Standard InChI: InChI=1S/C18H22N4O5/c1-24-14-7-12(8-15(25-2)16(14)26-3)20-17-19-9-11-10-22(18(23)27-4)6-5-13(11)21-17/h7-9H,5-6,10H2,1-4H3,(H,19,20,21)
Standard InChI Key: GZXJESNMBXPHCL-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 29 0 0 0 0 0 0 0 0999 V2000
3.6331 -3.6060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6375 -0.9049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1984 1.4977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.4971 0.7454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7988 1.4909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0952 0.7364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3961 1.4850 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-10.3985 2.6850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0900 -0.7636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3856 -1.5212 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-10.3798 -2.7212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7884 -1.5091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7801 -3.0099 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.7380 -3.6048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4920 -0.7546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 -0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
3 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 1 0
15 16 1 0
14 17 2 0
17 18 1 0
18 19 1 0
17 20 1 0
20 21 1 0
21 22 1 0
20 23 2 0
23 12 1 0
10 24 2 0
24 25 1 0
25 26 2 0
26 8 1 0
26 27 1 0
27 5 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 374.40Molecular Weight (Monoisotopic): 374.1590AlogP: 2.37#Rotatable Bonds: 5Polar Surface Area: 95.04Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.42CX Basic pKa: 0.87CX LogP: 1.55CX LogD: 1.55Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.85Np Likeness Score: -1.21
References 1. (2016) Piperidylpyrimidine derivatives as modulators of protein kinase inhibitors and of vascular endothelial growth factor receptor 2,