The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((4,6-dimethyl-2-oxo-1,2-dihydropyridin-3-yl)methyl)-3-methyl-6-(4-(morpholinomethyl)phenyl)-1-(tetrahydro-2H-pyran-4-yl)indoline-4-carboxamide ID: ALA3892623
PubChem CID: 134137113
Max Phase: Preclinical
Molecular Formula: C34H42N4O4
Molecular Weight: 570.73
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(C)c(CNC(=O)c2cc(-c3ccc(CN4CCOCC4)cc3)cc3c2C(C)CN3C2CCOCC2)c(=O)[nH]1
Standard InChI: InChI=1S/C34H42N4O4/c1-22-16-24(3)36-34(40)30(22)19-35-33(39)29-17-27(26-6-4-25(5-7-26)21-37-10-14-42-15-11-37)18-31-32(29)23(2)20-38(31)28-8-12-41-13-9-28/h4-7,16-18,23,28H,8-15,19-21H2,1-3H3,(H,35,39)(H,36,40)
Standard InChI Key: AGFJSOIBLBIMSF-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 47 0 0 0 0 0 0 0 0999 V2000
14.4086 -13.0538 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.8886 -12.3904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4082 -11.7314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6311 -11.9821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9260 -11.5738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2170 -11.9825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2173 -12.7997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9265 -13.2081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6313 -12.7993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9258 -10.7566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2166 -10.3482 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.6306 -10.3478 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.7127 -14.7745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4619 -13.9974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6635 -13.8268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1158 -14.4376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3707 -15.2147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1691 -15.3853 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5083 -13.2085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8032 -12.8001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0942 -13.2089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0945 -14.0261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8037 -14.4345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5085 -14.0257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3855 -14.4349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2620 -13.2097 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2622 -14.0269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9714 -14.4353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6763 -14.0265 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.6761 -13.2093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9710 -12.8009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6627 -10.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6304 -9.5306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3391 -8.3046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3394 -9.1218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0486 -9.5302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7534 -9.1214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7532 -8.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0481 -7.8958 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.6299 -7.8962 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.4622 -7.8954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0488 -10.3474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
1 9 1 0
4 9 2 0
10 11 2 0
10 12 1 0
5 10 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
13 18 1 0
1 15 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
19 24 2 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
26 31 1 0
25 29 1 0
22 25 1 0
7 19 1 0
3 32 1 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
34 39 1 0
34 40 2 0
38 41 1 0
36 42 1 0
33 35 1 0
12 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 570.73Molecular Weight (Monoisotopic): 570.3206AlogP: 4.52#Rotatable Bonds: 7Polar Surface Area: 86.90Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.64CX Basic pKa: 7.19CX LogP: 2.99CX LogD: 2.78Aromatic Rings: 3Heavy Atoms: 42QED Weighted: 0.43Np Likeness Score: -0.99
References 1. Ansari A, Satalkar S, Patil V, Shete AS, Kaur S, Gupta A, Singh S, Raja M, Severance DL, Bernales S, Chakravarty S, Hung DT, Pham SM, Herrera FJ, Rai R.. (2017) Novel 3-methylindoline inhibitors of EZH2: Design, synthesis and SAR., 27 (2): [PMID:27923618 ] [10.1016/j.bmcl.2016.11.080 ] 2. Ansari A, Satalkar S, Patil V, Shete AS, Kaur S, Gupta A, Singh S, Raja M, Severance DL, Bernales S, Chakravarty S, Hung DT, Pham SM, Herrera FJ, Rai R.. (2017) Novel 3-methylindoline inhibitors of EZH2: Design, synthesis and SAR., 27 (2): [PMID:27923618 ] [10.1016/j.bmcl.2016.11.080 ]