US9428501, 14

ID: ALA3892677

PubChem CID: 118378659

Max Phase: Preclinical

Molecular Formula: C33H36F3N5O2

Molecular Weight: 591.68

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(CN2CCC(c3ccc4nc(C(=O)N5CCN(Cc6ccc(C(F)(F)F)cc6)CC5)[nH]c4c3)CC2)cc1

Standard InChI:  InChI=1S/C33H36F3N5O2/c1-43-28-9-4-24(5-10-28)21-39-14-12-25(13-15-39)26-6-11-29-30(20-26)38-31(37-29)32(42)41-18-16-40(17-19-41)22-23-2-7-27(8-3-23)33(34,35)36/h2-11,20,25H,12-19,21-22H2,1H3,(H,37,38)

Standard InChI Key:  DCOPJZULHMHERN-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 43 48  0  0  0  0  0  0  0  0999 V2000
    5.4181  -10.3546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4612   -9.7614    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4719   -8.2606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7747   -7.5171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7822   -6.0171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4870   -5.2605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4915   -3.7597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1945   -3.0045    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1969   -1.5045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8991   -0.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5987   -1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5965   -3.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8943   -3.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7248    1.2135    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6065    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7248   -1.2135    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1047   -0.0031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7065    1.0350    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8532   -1.3040    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3533   -1.3093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.0987   -2.6109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3442   -3.9074    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -8.0874   -5.2113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3306   -6.5073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.0715   -7.8116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3125   -9.1054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8126   -9.0950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0716   -7.7908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8306   -6.4970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0531  -10.3895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6453  -11.4332    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8532  -10.3808    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4455  -11.4242    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8442   -3.9021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0987   -2.6005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1842   -6.0040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1766   -7.5040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13  8  1  0
 11 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  1  0
 21 17  1  0
 21 22  2  0
 22 14  1  0
 19 23  1  0
 23 24  2  0
 23 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
 33 36  1  0
 36 37  1  0
 36 38  1  0
 36 39  1  0
 28 40  1  0
 40 41  1  0
 41 25  1  0
  6 42  1  0
 42 43  2  0
 43  3  1  0
M  END

Associated Targets(Human)

PRKAA2 Tchem AMP-activated protein kinase, alpha-2 subunit (1328 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PIK3CA Tclin PI3-kinase p110-alpha subunit (12269 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 591.68Molecular Weight (Monoisotopic): 591.2821AlogP: 5.93#Rotatable Bonds: 7
Polar Surface Area: 64.70Molecular Species: BASEHBA: 5HBD: 1
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.04CX Basic pKa: 8.59CX LogP: 5.44CX LogD: 3.92
Aromatic Rings: 4Heavy Atoms: 43QED Weighted: 0.29Np Likeness Score: -1.08

References

1.  (2016)  Bicyclic nitrogen-containing aromatic heterocyclic amide compound, 

Source

Source(1):