The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9187470, 89 ID: ALA3895054
PubChem CID: 72721107
Max Phase: Preclinical
Molecular Formula: C24H32N6O2S
Molecular Weight: 468.63
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(-n2nc(C(C)(C)C)cc2NC(=O)Nc2ncc(CCN3CCOCC3)s2)cc1
Standard InChI: InChI=1S/C24H32N6O2S/c1-17-5-7-18(8-6-17)30-21(15-20(28-30)24(2,3)4)26-22(31)27-23-25-16-19(33-23)9-10-29-11-13-32-14-12-29/h5-8,15-16H,9-14H2,1-4H3,(H2,25,26,27,31)
Standard InChI Key: UHGSHQOTUMLQBJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
2.3383 -1.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5987 1.5004 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9492 0.8772 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.9546 1.9903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2067 3.2905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7390 2.9810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6216 3.9790 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9268 5.4485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0664 5.8243 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8074 6.4482 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.1126 7.9177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1015 9.0084 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.8481 10.3094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3161 10.0014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4290 11.0045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8569 10.5424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.9717 11.5473 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-7.3995 11.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.5116 12.0941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.1960 13.5605 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.7682 14.0203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6561 13.0138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4768 8.5100 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-6.4444 1.8313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.9314 0.7346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.1510 2.8013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.6377 1.7046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
5 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 8 1 0
12 13 1 0
13 14 1 0
14 15 2 0
14 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 23 1 0
20 29 1 0
29 17 1 0
10 30 1 0
30 31 1 0
30 32 1 0
30 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 468.63Molecular Weight (Monoisotopic): 468.2307AlogP: 4.45#Rotatable Bonds: 6Polar Surface Area: 84.31Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.40CX Basic pKa: 6.27CX LogP: 5.00CX LogD: 4.89Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.56Np Likeness Score: -2.31
References 1. (2015) Anti-mucus drugs and uses therefor,