US9187470, 89

ID: ALA3895054

PubChem CID: 72721107

Max Phase: Preclinical

Molecular Formula: C24H32N6O2S

Molecular Weight: 468.63

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(-n2nc(C(C)(C)C)cc2NC(=O)Nc2ncc(CCN3CCOCC3)s2)cc1

Standard InChI:  InChI=1S/C24H32N6O2S/c1-17-5-7-18(8-6-17)30-21(15-20(28-30)24(2,3)4)26-22(31)27-23-25-16-19(33-23)9-10-29-11-13-32-14-12-29/h5-8,15-16H,9-14H2,1-4H3,(H2,25,26,27,31)

Standard InChI Key:  UHGSHQOTUMLQBJ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
    2.3383   -1.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5987    1.5004    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9492    0.8772    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9546    1.9903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2067    3.2905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7390    2.9810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6216    3.9790    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9268    5.4485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0664    5.8243    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8074    6.4482    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1126    7.9177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1015    9.0084    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8481   10.3094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3161   10.0014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4290   11.0045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8569   10.5424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9717   11.5473    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3995   11.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.5116   12.0941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.1960   13.5605    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7682   14.0203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6561   13.0138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4768    8.5100    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4444    1.8313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9314    0.7346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1510    2.8013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6377    1.7046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  5  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  8  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 14 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 23  1  0
 20 29  1  0
 29 17  1  0
 10 30  1  0
 30 31  1  0
 30 32  1  0
 30 33  1  0
M  END

Associated Targets(Human)

MAPK13 Tchem MAP kinase p38 delta (2605 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 468.63Molecular Weight (Monoisotopic): 468.2307AlogP: 4.45#Rotatable Bonds: 6
Polar Surface Area: 84.31Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 7.40CX Basic pKa: 6.27CX LogP: 5.00CX LogD: 4.89
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.56Np Likeness Score: -2.31

References

1.  (2015)  Anti-mucus drugs and uses therefor, 

Source

Source(1):