The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9394303, 15 ID: ALA3895430
PubChem CID: 118414945
Max Phase: Preclinical
Molecular Formula: C26H22N4O4
Molecular Weight: 454.49
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nn(Cc2ccc(Oc3ccccc3)cc2)c2nc(NCc3ccco3)cc(C(=O)O)c12
Standard InChI: InChI=1S/C26H22N4O4/c1-17-24-22(26(31)32)14-23(27-15-21-8-5-13-33-21)28-25(24)30(29-17)16-18-9-11-20(12-10-18)34-19-6-3-2-4-7-19/h2-14H,15-16H2,1H3,(H,27,28)(H,31,32)
Standard InChI Key: FQUXGDMDQZSGRD-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
-0.4916 -3.8582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3114 -2.9665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8032 -3.1233 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4133 -1.7530 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8794 -1.4442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8823 -2.5608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3506 -2.2538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3506 -3.3718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8824 -4.7969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8807 -5.9175 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4102 -7.3427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4064 -8.4642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9332 -9.8877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4640 -10.1897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4678 -9.0682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9409 -7.6448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4142 -5.1039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4142 -3.9859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 3.0008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3039 3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3070 5.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5205 6.1100 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.0570 7.5366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5570 7.5366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0935 6.1100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6003 -1.4978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6387 -0.8963 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6024 -2.6978 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
9 17 1 0
17 18 2 0
18 6 1 0
4 19 1 0
19 20 2 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 24 2 0
21 29 2 0
29 30 1 0
30 31 1 0
31 32 2 0
31 33 1 0
30 34 2 0
34 2 1 0
34 19 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 454.49Molecular Weight (Monoisotopic): 454.1641AlogP: 5.48#Rotatable Bonds: 8Polar Surface Area: 102.41Molecular Species: ACIDHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.26CX Basic pKa: 1.98CX LogP: 4.44CX LogD: 1.44Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.32Np Likeness Score: -1.45
References 1. (2016) Small molecule inhibitors of MCL-1 and uses thereof,