US9394303, 15

ID: ALA3895430

PubChem CID: 118414945

Max Phase: Preclinical

Molecular Formula: C26H22N4O4

Molecular Weight: 454.49

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1nn(Cc2ccc(Oc3ccccc3)cc2)c2nc(NCc3ccco3)cc(C(=O)O)c12

Standard InChI:  InChI=1S/C26H22N4O4/c1-17-24-22(26(31)32)14-23(27-15-21-8-5-13-33-21)28-25(24)30(29-17)16-18-9-11-20(12-10-18)34-19-6-3-2-4-7-19/h2-14H,15-16H2,1H3,(H,27,28)(H,31,32)

Standard InChI Key:  FQUXGDMDQZSGRD-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   -0.4916   -3.8582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3114   -2.9665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8032   -3.1233    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4133   -1.7530    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8794   -1.4442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8823   -2.5608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3506   -2.2538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3506   -3.3718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8824   -4.7969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8807   -5.9175    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4102   -7.3427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4064   -8.4642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9332   -9.8877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4640  -10.1897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4678   -9.0682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9409   -7.6448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4142   -5.1039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4142   -3.9859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0031    3.0008    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3039    3.7494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3070    5.2502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5205    6.1100    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0570    7.5366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5570    7.5366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0935    6.1100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6003   -1.4978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6387   -0.8963    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6024   -2.6978    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  9 17  1  0
 17 18  2  0
 18  6  1  0
  4 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 24  2  0
 21 29  2  0
 29 30  1  0
 30 31  1  0
 31 32  2  0
 31 33  1  0
 30 34  2  0
 34  2  1  0
 34 19  1  0
M  END

Associated Targets(non-human)

Mcl1 Induced myeloid leukemia cell differentiation protein Mcl-1 homolog (108 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 454.49Molecular Weight (Monoisotopic): 454.1641AlogP: 5.48#Rotatable Bonds: 8
Polar Surface Area: 102.41Molecular Species: ACIDHBA: 7HBD: 2
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.26CX Basic pKa: 1.98CX LogP: 4.44CX LogD: 1.44
Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.32Np Likeness Score: -1.45

References

1.  (2016)  Small molecule inhibitors of MCL-1 and uses thereof, 

Source

Source(1):