The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-6-chloro-N-(4-(1-(2-(dimethylamino)-8-methylquinazolin-4-ylamino)ethyl)phenyl)nicotinamide ID: ALA3897423
PubChem CID: 87630402
Max Phase: Preclinical
Molecular Formula: C25H25ClN6O
Molecular Weight: 460.97
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cccc2c(N[C@@H](C)c3ccc(NC(=O)c4ccc(Cl)nc4)cc3)nc(N(C)C)nc12
Standard InChI: InChI=1S/C25H25ClN6O/c1-15-6-5-7-20-22(15)30-25(32(3)4)31-23(20)28-16(2)17-8-11-19(12-9-17)29-24(33)18-10-13-21(26)27-14-18/h5-14,16H,1-4H3,(H,29,33)(H,28,30,31)/t16-/m0/s1
Standard InChI Key: QLOFWZQHBRWCBS-INIZCTEOSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
38.0356 -3.5391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3265 -3.9477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3265 -4.7649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6174 -5.1735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9124 -4.7649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9124 -3.9477 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.6174 -3.5391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0356 -2.7219 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.7405 -3.9477 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.4496 -3.5391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4496 -2.7219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1587 -2.3133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8678 -2.7219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8678 -3.5391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1587 -3.9477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5728 -2.3133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5728 -1.4961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.2818 -2.7219 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.2818 -5.1735 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.5728 -4.7649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5728 -3.9477 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.2818 -3.5391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.9868 -3.9477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.6959 -3.5391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.4050 -3.9477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.4050 -4.7649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.6959 -5.1735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.9868 -4.7649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.6959 -5.9907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8678 -5.1735 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.1587 -4.7649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8678 -5.9907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2033 -5.1735 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
2 7 2 0
1 8 2 0
1 9 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
10 15 2 0
16 17 1 6
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
19 28 2 0
23 28 1 0
27 29 1 0
30 31 1 0
30 32 1 0
20 30 1 0
18 22 1 0
16 18 1 0
13 16 1 0
9 10 1 0
5 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 460.97Molecular Weight (Monoisotopic): 460.1778AlogP: 5.48#Rotatable Bonds: 6Polar Surface Area: 83.04Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 6.53CX LogP: 5.63CX LogD: 5.58Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.37Np Likeness Score: -1.76
References 1. (2009) Amino-substituted quinazoline derivatives as inhibitors of Beta-catenin/TCF-4 pathway and cancer treatment agents,