((2R,5R)-2-Benzyl-5-(cyclopropylmethoxy)piperidin-1-yl)(4-(bis(4-fluorophenyl)(hydroxy)methyl)-2H-1,2,3-triazol-2-yl)-methanone

ID: ALA3897587

PubChem CID: 134133947

Max Phase: Preclinical

Molecular Formula: C32H32F2N4O3

Molecular Weight: 558.63

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(N1C[C@H](OCC2CC2)CC[C@@H]1Cc1ccccc1)n1ncc(C(O)(c2ccc(F)cc2)c2ccc(F)cc2)n1

Standard InChI:  InChI=1S/C32H32F2N4O3/c33-26-12-8-24(9-13-26)32(40,25-10-14-27(34)15-11-25)30-19-35-38(36-30)31(39)37-20-29(41-21-23-6-7-23)17-16-28(37)18-22-4-2-1-3-5-22/h1-5,8-15,19,23,28-29,40H,6-7,16-18,20-21H2/t28-,29-/m1/s1

Standard InChI Key:  LGBQVORQOWSIEF-FQLXRVMXSA-N

Molfile:  

     RDKit          2D

 41 46  0  0  0  0  0  0  0  0999 V2000
   13.4292   -5.6083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5697   -4.9719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5563   -4.1434    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.3871   -6.1906    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.2950   -5.3773    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.0403   -5.0191    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.6007   -5.6257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2016   -6.3502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8557   -5.3991    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.8691   -6.2276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1550   -6.6549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4296   -6.2499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4218   -5.4197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1336   -4.9965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1164   -4.1674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3935   -3.7699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8565   -6.3140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8265   -4.8853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2541   -5.6083    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.6505   -4.8724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0479   -4.1504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6205   -3.4437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7914   -3.4637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3978   -4.1863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4548   -7.0341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8815   -7.7392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7072   -7.7224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1043   -6.9944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6754   -6.2922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1355   -8.4276    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   15.0169   -2.7202    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.3810   -2.9470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6590   -2.5495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9523   -2.9769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9722   -3.8059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6947   -4.1996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1675   -7.4798    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4593   -7.9030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4717   -8.7279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0732   -9.4492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8981   -9.4368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  4  8  2  0
  7  1  1  0
  2  5  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
  9 14  1  0
  2  9  1  0
 14 15  1  6
 15 16  1  0
  1 17  1  0
  1 18  1  0
  1 19  1  0
 18 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 18  1  0
 17 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 17  1  0
 27 30  1  0
 22 31  1  0
 16 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 16  1  0
 11 37  1  6
 37 38  1  0
 38 39  1  0
 40 39  1  0
 41 40  1  0
 39 41  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3897587

    ---

Associated Targets(Human)

ABHD6 Tchem Monoacylglycerol lipase ABHD6 (331 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
DAGLA Tchem Sn1-specific diacylglycerol lipase alpha (416 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Abhd6 Monoacylglycerol lipase ABHD6 (221 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Dagla Sn1-specific diacylglycerol lipase alpha (127 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 558.63Molecular Weight (Monoisotopic): 558.2442AlogP: 5.31#Rotatable Bonds: 8
Polar Surface Area: 80.48Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.68CX Basic pKa: CX LogP: 5.54CX LogD: 5.54
Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.32Np Likeness Score: -0.62

References

1. Deng H, Kooijman S, van den Nieuwendijk AM, Ogasawara D, van der Wel T, van Dalen F, Baggelaar MP, Janssen FJ, van den Berg RJ, den Dulk H, Cravatt BF, Overkleeft HS, Rensen PC, van der Stelt M..  (2017)  Triazole Ureas Act as Diacylglycerol Lipase Inhibitors and Prevent Fasting-Induced Refeeding.,  60  (1): [PMID:27992221] [10.1021/acs.jmedchem.6b01482]

Source