US9283225, A1

ID: ALA3899652

PubChem CID: 71261882

Max Phase: Preclinical

Molecular Formula: C24H16F4N6O3

Molecular Weight: 512.42

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C1NCc2c(Oc3ccc(NC(=O)c4cnn(-c5ccccc5)c4C(F)(F)F)cc3F)ccnc2N1

Standard InChI:  InChI=1S/C24H16F4N6O3/c25-17-10-13(6-7-19(17)37-18-8-9-29-21-15(18)11-30-23(36)33-21)32-22(35)16-12-31-34(20(16)24(26,27)28)14-4-2-1-3-5-14/h1-10,12H,11H2,(H,32,35)(H2,29,30,33,36)

Standard InChI Key:  NDMHWVQYGCWZAS-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
    5.2049   -2.6909    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.2007   -1.4909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4972   -0.7364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4920    0.7636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7876    1.5211    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7802    3.0220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7379    3.6165    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0758    3.7795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4294    3.1632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4292    4.2814    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.6747    5.5778    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.2803    6.9509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7504    7.2228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2508    8.6369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2764    9.7773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8015    9.5036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3012    8.0895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2086    5.2608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0841    6.2509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3197    7.4275    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.9472    5.8669    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.1830    7.0434    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.1903    1.5091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8939    0.7546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8990   -0.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6373   -3.6000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -3.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  6  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 11 18  1  0
 18  8  2  0
 18 19  1  0
 19 20  1  0
 19 21  1  0
 19 22  1  0
  4 23  2  0
 23 24  1  0
 24 25  2  0
 25  2  1  0
 25 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  2  0
 33 35  1  0
 35 36  1  0
 36 37  1  0
 37 27  1  0
 37 31  2  0
M  END

Associated Targets(Human)

MST1R Tchem Macrophage-stimulating protein receptor (2327 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 512.42Molecular Weight (Monoisotopic): 512.1220AlogP: 5.10#Rotatable Bonds: 5
Polar Surface Area: 110.17Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.56CX Basic pKa: 4.46CX LogP: 3.85CX LogD: 3.85
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.32Np Likeness Score: -1.60

References

1.  (2016)  Pyrido-pyrimidine derivatives, 

Source

Source(1):