The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2R,3S)1-[4-(2-methyl-benzyloxy)-benzenesulfonyl]-3-hydroxy-3-methyl-piperidine-2-carboxylicacid hydroxyamide ID: ALA3899940
PubChem CID: 58619810
Max Phase: Preclinical
Molecular Formula: C21H26N2O6S
Molecular Weight: 434.51
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccccc1COc1ccc(S(=O)(=O)N2CCC[C@](C)(O)[C@@H]2C(=O)NO)cc1
Standard InChI: InChI=1S/C21H26N2O6S/c1-15-6-3-4-7-16(15)14-29-17-8-10-18(11-9-17)30(27,28)23-13-5-12-21(2,25)19(23)20(24)22-26/h3-4,6-11,19,25-26H,5,12-14H2,1-2H3,(H,22,24)/t19-,21-/m0/s1
Standard InChI Key: FYNYGUYHKZWCAU-FPOVZHCZSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
5.5883 -7.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2982 -6.9998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5929 -6.5872 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1731 -5.1219 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8830 -5.5305 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.8819 -4.7114 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5003 -6.2512 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6836 -6.2793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7322 -7.6939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5489 -7.6658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9330 -6.9445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2509 -5.5860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6350 -4.8647 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4342 -5.6141 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0016 -4.9208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7014 -5.5314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1100 -4.8237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9271 -4.8237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3357 -5.5314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9271 -6.2391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1100 -6.2391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1529 -5.5314 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5615 -6.2391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3787 -6.2391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7873 -5.5314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6045 -5.5314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0131 -6.2391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6045 -6.9468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7873 -6.9468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3787 -4.8237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 6
5 4 2 0
6 5 2 0
7 8 1 0
8 2 1 0
2 9 1 0
9 10 1 0
10 11 1 0
7 11 1 0
12 13 2 0
14 15 1 0
12 14 1 0
8 12 1 6
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
16 21 2 0
5 16 1 0
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
24 29 2 0
22 23 1 0
19 22 1 0
7 5 1 0
25 30 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 434.51Molecular Weight (Monoisotopic): 434.1512AlogP: 1.98#Rotatable Bonds: 6Polar Surface Area: 116.17Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.68CX Basic pKa: ┄CX LogP: 2.04CX LogD: 2.02Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.47Np Likeness Score: -0.75
References 1. (2001) Selective inhibitors of aggrecanase in osteoarthritis treatment,