3-(1-{(2Z)-4-[9-(4-Methoxyphenyl)-9H-fluoren-9-yloxy]but-2-en-1-yl}-1H-imidazol-2-yl)propanoi acid

ID: ALA3900098

PubChem CID: 134134197

Max Phase: Preclinical

Molecular Formula: C30H28N2O4

Molecular Weight: 480.56

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  COc1ccc(C2(OC/C=C\Cn3ccnc3CCC(=O)O)c3ccccc3-c3ccccc32)cc1

Standard InChI:  InChI=1S/C30H28N2O4/c1-35-23-14-12-22(13-15-23)30(26-10-4-2-8-24(26)25-9-3-5-11-27(25)30)36-21-7-6-19-32-20-18-31-28(32)16-17-29(33)34/h2-15,18,20H,16-17,19,21H2,1H3,(H,33,34)/b7-6-

Standard InChI Key:  PIEZLFLTLKUGEC-SREVYHEPSA-N

Molfile:  

     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   27.7675  -10.3310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4272  -10.8133    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.0910  -10.3365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8404   -9.5560    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.0241   -9.5564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8670  -10.5925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4767  -10.0484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2528  -10.3044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8625   -9.7603    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.4192  -11.1045    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.1408  -14.4931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7322  -15.7519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4855  -14.9777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6933  -14.8055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1469  -15.4067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3983  -16.1827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1899  -16.3512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8037  -14.9752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5485  -15.7515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0926  -16.3587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8922  -16.1908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1446  -15.4103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5988  -14.8064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8440  -14.0780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5547  -14.4823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2574  -14.0679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2499  -13.2505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5339  -12.8493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8341  -13.2660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9531  -12.8341    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.6653  -13.2349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4284  -14.0821    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.4281  -13.2649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7202  -12.8566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7199  -12.0394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4275  -11.6305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  1  2  0
  3  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  8 10  2  0
 12 19  1  0
 18 11  1  0
 11 13  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 11 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 27 30  1  0
 30 31  1  0
 11 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36  2  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA3900098

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 480.56

Molecular Weight (Monoisotopic): 480.2049

AlogP: 5.45

#Rotatable Bonds: 10

Polar Surface Area: 73.58

Molecular Species: ACID

HBA: 5

HBD: 1

#RO5 Violations: 1

HBA (Lipinski): 6

HBD (Lipinski): 1

#RO5 Violations (Lipinski): 1

CX Acidic pKa: 4.16

CX Basic pKa: 6.36

CX LogP: 3.94

CX LogD: 2.87

Aromatic Rings: 4

Heavy Atoms: 36

QED Weighted: 0.31

Np Likeness Score: -0.10

References

1. Kerscher-Hack S, Renukappa-Gutke T, Höfner G, Wanner KT..  (2016)  Synthesis and biological evaluation of a series of N-alkylated imidazole alkanoic acids as mGAT3 selective GABA uptake inhibitors.,  124  [PMID:27654218] [10.1016/j.ejmech.2016.09.012]

Source

Source(1):

• Scientific Literature