4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)biphenyl-3-ol

ID: ALA3901405

PubChem CID: 134134309

Max Phase: Preclinical

Molecular Formula: C15H10F6O2

Molecular Weight: 336.23

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Oc1cc(-c2ccccc2)ccc1C(O)(C(F)(F)F)C(F)(F)F

Standard InChI:  InChI=1S/C15H10F6O2/c16-14(17,18)13(23,15(19,20)21)11-7-6-10(8-12(11)22)9-4-2-1-3-5-9/h1-8,22-23H

Standard InChI Key:  ORBXCICUKBESFR-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 23 24  0  0  0  0  0  0  0  0999 V2000
   21.4987   -2.8272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6733   -2.8272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0860   -3.5390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5668   -3.2414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5660   -4.0448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2645   -4.4538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9634   -4.0462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9637   -3.2419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2633   -2.8336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6705   -2.0017    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.4630   -4.1931    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   20.7836   -4.3473    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   21.8724   -3.8670    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   22.2506   -2.8272    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   22.1250   -3.3983    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   22.0465   -2.1569    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   19.2625   -2.0082    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.8516   -4.4523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1411   -4.0351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4240   -4.4444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4203   -5.2707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1397   -5.6860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8497   -5.2744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  8  2  1  0
  2 10  1  0
  3 11  1  0
  3 12  1  0
  3 13  1  0
  1 14  1  0
  1 15  1  0
  1 16  1  0
  9 17  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
  5 18  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3901405

    ---

Associated Targets(Human)

PTPN13 Tchem Protein-tyrosine phosphatase 1E (88 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PTPN22 Tchem Hematopoietic cell protein-tyrosine phosphatase 70Z-PEP (1215 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PTPRC Tchem Leukocyte common antigen (2317 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PTPN1 Tchem Protein-tyrosine phosphatase 1B (8528 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PTPN11 Tchem Protein-tyrosine phosphatase 2C (2297 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 336.23Molecular Weight (Monoisotopic): 336.0585AlogP: 4.37#Rotatable Bonds: 2
Polar Surface Area: 40.46Molecular Species: NEUTRALHBA: 2HBD: 2
#RO5 Violations: HBA (Lipinski): 2HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 7.22CX Basic pKa: CX LogP: 4.44CX LogD: 4.04
Aromatic Rings: 2Heavy Atoms: 23QED Weighted: 0.80Np Likeness Score: 0.02

References

1. Li Y, Xia G, Guo Q, Wu L, Chen S, Yang Z, Wang W, Zhang ZY, Zhou X, Jiang ZX..  (2016)  Design, synthesis and evaluation of novel 19F magnetic resonance sensitive protein tyrosine phosphatase inhibitors.,  (8): [PMID:27529021] [10.1039/C6MD00277C]
2. He, Yantao Y and 11 more authors.  2013-06-27  A potent and selective small-molecule inhibitor for the lymphoid-specific tyrosine phosphatase (LYP), a target associated with autoimmune diseases.  [PMID:23713581]

Source