N-((4,6-dimethyl-2-oxo-1,2-dihydropyridin-3-yl)methyl)-1-isopropyl-3-methyl-6-(6-(piperazin-1-yl)pyridin-3-yl)indoline-4-carboxamide

ID: ALA3901570

PubChem CID: 134135389

Max Phase: Preclinical

Molecular Formula: C30H38N6O2

Molecular Weight: 514.67

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  Cc1cc(C)c(CNC(=O)c2cc(-c3ccc(N4CCNCC4)nc3)cc3c2C(C)CN3C(C)C)c(=O)[nH]1

Standard InChI:  InChI=1S/C30H38N6O2/c1-18(2)36-17-20(4)28-24(29(37)33-16-25-19(3)12-21(5)34-30(25)38)13-23(14-26(28)36)22-6-7-27(32-15-22)35-10-8-31-9-11-35/h6-7,12-15,18,20,31H,8-11,16-17H2,1-5H3,(H,33,37)(H,34,38)

Standard InChI Key:  FEZWVJGCJOKBGK-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
   14.1601  -12.9634    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.6395  -12.2996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1586  -11.6410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3816  -11.8924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6721  -11.4846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9635  -11.8940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9644  -12.7111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6739  -13.1190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3826  -12.7096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6712  -10.6674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9617  -10.2596    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.3798  -10.2580    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.2608  -13.9377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2599  -13.1205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5503  -12.7127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8417  -13.1221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8426  -13.9393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5521  -14.3471    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1340  -14.3487    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.4285  -13.9409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7199  -14.3502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7208  -15.1674    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.4304  -15.5752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1349  -15.1659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4083  -10.8594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4115  -13.7362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8337  -14.3152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2100  -13.9061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3789   -9.4408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0867   -8.2142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0876   -9.0314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7930   -9.4392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5016   -9.0299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5007   -8.2127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7953   -7.8049    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.3771   -7.8064    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.2093   -7.8033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7939  -10.2564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  1  9  1  0
  4  9  2  0
 10 11  2  0
 10 12  1  0
  5 10  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 13 18  2  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 19 24  1  0
 17 19  1  0
  7 14  1  0
  3 25  1  0
 26 27  1  0
 26 28  1  0
  1 26  1  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 30 35  1  0
 30 36  2  0
 34 37  1  0
 32 38  1  0
 29 31  1  0
 12 29  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA3901570

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 514.67

Molecular Weight (Monoisotopic): 514.3056

AlogP: 3.73

#Rotatable Bonds: 6

Polar Surface Area: 93.36

Molecular Species: BASE

HBA: 6

HBD: 3

#RO5 Violations: 1

HBA (Lipinski): 8

HBD (Lipinski): 3

#RO5 Violations (Lipinski): 1

CX Acidic pKa: 11.64

CX Basic pKa: 8.79

CX LogP: 3.03

CX LogD: 1.63

Aromatic Rings: 3

Heavy Atoms: 38

QED Weighted: 0.46

Np Likeness Score: -1.27

References

1. Ansari A, Satalkar S, Patil V, Shete AS, Kaur S, Gupta A, Singh S, Raja M, Severance DL, Bernales S, Chakravarty S, Hung DT, Pham SM, Herrera FJ, Rai R..  (2017)  Novel 3-methylindoline inhibitors of EZH2: Design, synthesis and SAR.,  27  (2): [PMID:27923618] [10.1016/j.bmcl.2016.11.080]

2. Ansari A, Satalkar S, Patil V, Shete AS, Kaur S, Gupta A, Singh S, Raja M, Severance DL, Bernales S, Chakravarty S, Hung DT, Pham SM, Herrera FJ, Rai R..  (2017)  Novel 3-methylindoline inhibitors of EZH2: Design, synthesis and SAR.,  27  (2): [PMID:27923618] [10.1016/j.bmcl.2016.11.080]

Source

Source(1):

• Scientific Literature