N-(4-morpholino-2-(3-(naphthalene-2-sulfonamido)phenyl)quinazolin-6-yl)acetamide

ID: ALA3903959

PubChem CID: 134136095

Max Phase: Preclinical

Molecular Formula: C30H27N5O4S

Molecular Weight: 553.64

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)Nc1ccc2nc(-c3cccc(NS(=O)(=O)c4ccc5ccccc5c4)c3)nc(N3CCOCC3)c2c1

Standard InChI:  InChI=1S/C30H27N5O4S/c1-20(36)31-24-10-12-28-27(19-24)30(35-13-15-39-16-14-35)33-29(32-28)23-7-4-8-25(17-23)34-40(37,38)26-11-9-21-5-2-3-6-22(21)18-26/h2-12,17-19,34H,13-16H2,1H3,(H,31,36)

Standard InChI Key:  FFNCFGWKXFOXPA-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 40 45  0  0  0  0  0  0  0  0999 V2000
    9.2739  -19.2288    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8694  -18.5230    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.4604  -19.2262    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5079  -17.3302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5068  -18.1497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2148  -18.5587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2130  -16.9213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9217  -17.3266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9224  -18.1456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6310  -18.5527    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3392  -18.1419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3345  -17.3197    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6254  -16.9164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6174  -16.0995    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3248  -15.6883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3224  -14.8747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6143  -14.4660    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9070  -14.8772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9077  -15.6970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0450  -18.5436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0468  -19.3619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7553  -19.7677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4624  -19.3563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4565  -18.5349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7475  -18.1328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1612  -18.1210    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.5766  -18.1105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2859  -18.5179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9901  -18.1047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5675  -17.2990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2688  -16.8836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9811  -17.2852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6830  -16.8693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6738  -16.0518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9568  -15.6521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2579  -16.0703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8001  -16.9218    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0925  -17.3305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3847  -16.9221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0927  -18.1477    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  9  2  0
  8  7  2  0
  7  4  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
 14 15  1  0
 14 19  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 13 14  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 11 20  1  0
 24 26  1  0
 26  2  1  0
  2 27  1  0
 27 28  2  0
 28 29  1  0
 29 32  2  0
 31 30  2  0
 30 27  1  0
 31 32  1  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 31  1  0
  4 37  1  0
 37 38  1  0
 38 39  1  0
 38 40  2  0
M  END

Alternative Forms

  1. Parent:

    ALA3903959

    ---

Associated Targets(Human)

PIK3C2B Tchem Phosphatidylinositol-4-phosphate 3-kinase C2 domain-containing beta polypeptide (438 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 553.64Molecular Weight (Monoisotopic): 553.1784AlogP: 5.05#Rotatable Bonds: 6
Polar Surface Area: 113.52Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 7.70CX Basic pKa: 4.82CX LogP: 5.21CX LogD: 5.05
Aromatic Rings: 5Heavy Atoms: 40QED Weighted: 0.30Np Likeness Score: -1.91

References

1. Falasca M, Hamilton JR, Selvadurai M, Sundaram K, Adamska A, Thompson PE..  (2017)  Class II Phosphoinositide 3-Kinases as Novel Drug Targets.,  60  (1): [PMID:27644332] [10.1021/acs.jmedchem.6b00963]

Source