The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Crinipellin E ID: ALA3904582
PubChem CID: 134135130
Max Phase: Preclinical
Molecular Formula: C20H28O4
Molecular Weight: 332.44
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)[C@H]1CC[C@]23C[C@@H]4[C@H](C)C(=O)[C@H]5O[C@]54[C@@]2(C)[C@@H](O)C(=O)[C@]13C
Standard InChI: InChI=1S/C20H28O4/c1-9(2)11-6-7-19-8-12-10(3)13(21)16-20(12,24-16)18(19,5)15(23)14(22)17(11,19)4/h9-12,15-16,23H,6-8H2,1-5H3/t10-,11+,12+,15-,16+,17-,18-,19+,20-/m0/s1
Standard InChI Key: QRAOOADPSNNYON-GUMRYWFSSA-N
Molfile:
RDKit 2D
26 30 0 0 0 0 0 0 0 0999 V2000
8.1111 -6.1359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8564 -6.9132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5197 -7.3974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1793 -6.9097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9283 -6.1359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4125 -5.4727 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.8462 -7.3974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5957 -8.1788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7743 -8.1788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2589 -8.6589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9181 -8.1788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6675 -7.3974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2589 -6.6883 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6994 -8.4293 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2589 -9.4761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3410 -8.9560 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
9.7577 -6.3314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2650 -8.1788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4478 -8.1788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1931 -7.3974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4118 -7.1428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7756 -7.6578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2410 -6.3402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1931 -6.4330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6268 -5.4727 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4682 -7.2224 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
5 6 1 6
7 4 1 0
8 7 1 0
9 8 1 0
3 9 1 0
8 10 1 0
10 11 1 0
11 12 1 0
12 7 1 0
12 13 1 0
7 13 1 6
11 14 2 0
10 15 1 1
8 16 1 6
4 17 1 1
3 18 1 1
19 18 1 0
20 19 1 0
2 20 1 0
20 21 1 6
21 22 1 0
21 23 1 0
2 24 1 6
1 25 2 0
12 26 1 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 332.44Molecular Weight (Monoisotopic): 332.1988AlogP: 2.37#Rotatable Bonds: 1Polar Surface Area: 66.90Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.85CX Basic pKa: ┄CX LogP: 3.02CX LogD: 3.02Aromatic Rings: ┄Heavy Atoms: 24QED Weighted: 0.75Np Likeness Score: 2.47
References 1. Rohr M, Oleinikov K, Jung M, Sandjo LP, Opatz T, Erkel G.. (2017) Anti-inflammatory tetraquinane diterpenoids from a Crinipellis species., 25 (2): [PMID:27887964 ] [10.1016/j.bmc.2016.11.016 ]