US9447087, 102

ID: ALA3904979

PubChem CID: 46926078

Max Phase: Preclinical

Molecular Formula: C19H16ClN9O2S

Molecular Weight: 469.92

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC1=C(C(=O)Nc2nncs2)C(c2nn(C)cc2Cl)N=C(Nc2nc3ccccc3o2)N1

Standard InChI:  InChI=1S/C19H16ClN9O2S/c1-9-13(16(30)25-19-27-21-8-32-19)15(14-10(20)7-29(2)28-14)24-17(22-9)26-18-23-11-5-3-4-6-12(11)31-18/h3-8,15H,1-2H3,(H,25,27,30)(H2,22,23,24,26)

Standard InChI Key:  GBHCOJPBNMRJIK-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   -1.6572   -7.0081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4572   -7.0123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2883   -8.3139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7883   -8.3192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5428   -7.0227    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7974   -5.7210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5497   -4.4224    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8032   -3.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4133   -1.7530    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3114   -2.9665    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2973   -5.7159    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5341   -9.6214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0147   -9.7621    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.3238  -11.2299    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.4192  -11.7201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0234  -11.9775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9106  -10.9717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7349  -11.2120    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -0.4640   -9.6126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6640   -9.6106    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2838  -10.9139    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4685  -12.2126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1479  -13.5662    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9703  -14.5660    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2668  -13.8115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9498  -12.3453    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
 15 16  1  0
 16  8  2  0
  6 17  1  0
 17  2  1  0
  4 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  1  0
 20 22  1  0
 22 23  2  0
 23 18  1  0
 23 24  1  0
  3 25  1  0
 25 26  2  0
 25 27  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 28  1  0
M  END

Associated Targets(Human)

GALK1 Tbio Galactokinase (959 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 469.92Molecular Weight (Monoisotopic): 469.0836AlogP: 3.09#Rotatable Bonds: 4
Polar Surface Area: 135.15Molecular Species: NEUTRALHBA: 11HBD: 3
#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 6.83CX Basic pKa: 3.81CX LogP: 2.06CX LogD: 1.46
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.41Np Likeness Score: -1.92

References

1.  (2016)  Galactokinase inhibitors for the treatment and prevention of associated diseases and disorders, 
2.  (2021)  Galactokinase inhibitors, 
3.  (2019)  Galactokinase inhibitors for the treatment and prevention of associated diseases and disorders,