The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9447087, 102 ID: ALA3904979
PubChem CID: 46926078
Max Phase: Preclinical
Molecular Formula: C19H16ClN9O2S
Molecular Weight: 469.92
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC1=C(C(=O)Nc2nncs2)C(c2nn(C)cc2Cl)N=C(Nc2nc3ccccc3o2)N1
Standard InChI: InChI=1S/C19H16ClN9O2S/c1-9-13(16(30)25-19-27-21-8-32-19)15(14-10(20)7-29(2)28-14)24-17(22-9)26-18-23-11-5-3-4-6-12(11)31-18/h3-8,15H,1-2H3,(H,25,27,30)(H2,22,23,24,26)
Standard InChI Key: GBHCOJPBNMRJIK-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
-1.6572 -7.0081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4572 -7.0123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2883 -8.3139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7883 -8.3192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5428 -7.0227 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7974 -5.7210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5497 -4.4224 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8032 -3.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4133 -1.7530 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3114 -2.9665 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2973 -5.7159 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5341 -9.6214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0147 -9.7621 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3238 -11.2299 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4192 -11.7201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0234 -11.9775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9106 -10.9717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7349 -11.2120 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-0.4640 -9.6126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6640 -9.6106 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2838 -10.9139 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.4685 -12.2126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1479 -13.5662 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.9703 -14.5660 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.2668 -13.8115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9498 -12.3453 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
15 16 1 0
16 8 2 0
6 17 1 0
17 2 1 0
4 18 1 0
18 19 2 0
19 20 1 0
20 21 1 0
20 22 1 0
22 23 2 0
23 18 1 0
23 24 1 0
3 25 1 0
25 26 2 0
25 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 469.92Molecular Weight (Monoisotopic): 469.0836AlogP: 3.09#Rotatable Bonds: 4Polar Surface Area: 135.15Molecular Species: NEUTRALHBA: 11HBD: 3#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 6.83CX Basic pKa: 3.81CX LogP: 2.06CX LogD: 1.46Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.41Np Likeness Score: -1.92
References 1. (2016) Galactokinase inhibitors for the treatment and prevention of associated diseases and disorders, 2. (2021) Galactokinase inhibitors, 3. (2019) Galactokinase inhibitors for the treatment and prevention of associated diseases and disorders,