The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2R,3S)4-[4-(2,4-difluorobenzyloxy)-benzenesulfonyl]-3-methyl-4-carboxylicacidmethylamidepiperazine-2-carboxylicacid hydroxyamide ID: ALA3905996
PubChem CID: 58619822
Max Phase: Preclinical
Molecular Formula: C21H24F2N4O6S
Molecular Weight: 498.51
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CNC(=O)N1CCN(S(=O)(=O)c2ccc(OCc3ccc(F)cc3F)cc2)[C@@H](C(=O)NO)[C@@H]1C
Standard InChI: InChI=1S/C21H24F2N4O6S/c1-13-19(20(28)25-30)27(10-9-26(13)21(29)24-2)34(31,32)17-7-5-16(6-8-17)33-12-14-3-4-15(22)11-18(14)23/h3-8,11,13,19,30H,9-10,12H2,1-2H3,(H,24,29)(H,25,28)/t13-,19+/m0/s1
Standard InChI Key: OGLDBCLDYORWEH-ORAYPTAESA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
13.6025 -11.2740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7733 -18.6566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7601 -13.7317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7634 -15.3689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7530 -12.9088 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.0543 -14.9653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3462 -18.6571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7659 -16.1897 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4722 -14.1387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0325 -10.0362 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7705 -17.8303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8905 -11.6795 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.9322 -12.9046 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3473 -17.8339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0610 -19.0659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4651 -12.4952 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.0359 -11.6779 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1765 -10.4462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0592 -17.4211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7437 -10.4472 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.1739 -11.2671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6410 -17.4215 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.4581 -11.6754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1721 -12.9128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8861 -12.5028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3482 -12.1964 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.6058 -10.4533 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.3070 -11.6853 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0567 -16.6002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4744 -14.9588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7454 -11.2681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3137 -10.0437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0487 -14.1466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0618 -19.8831 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 27 1 0
31 17 2 0
16 24 1 0
14 7 2 0
11 19 2 0
26 5 2 0
19 14 1 0
1 28 2 0
15 2 2 0
23 31 1 1
29 8 1 0
21 18 1 6
30 9 1 0
9 3 2 0
3 5 1 0
21 23 1 0
25 12 1 0
4 30 2 0
24 25 1 0
2 11 1 0
14 22 1 0
27 32 1 0
33 6 2 0
16 23 1 0
8 4 1 0
7 15 1 0
12 1 1 0
19 29 1 0
12 21 1 0
3 33 1 0
6 4 1 0
31 20 1 0
20 10 1 0
5 13 2 0
5 16 1 0
15 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 498.51Molecular Weight (Monoisotopic): 498.1385AlogP: 1.45#Rotatable Bonds: 6Polar Surface Area: 128.28Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.70CX Basic pKa: ┄CX LogP: 1.14CX LogD: 1.12Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.41Np Likeness Score: -1.19
References 1. (2001) Selective inhibitors of aggrecanase in osteoarthritis treatment,