The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9187406, compound 5 ID: ALA3906163
PubChem CID: 121595889
Max Phase: Preclinical
Molecular Formula: C24H28N2O2
Molecular Weight: 376.50
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)Cc1ccc(/C=C/C(=O)CC(=O)/C=C/c2ccc(N(C)C)cc2)cc1
Standard InChI: InChI=1S/C24H28N2O2/c1-25(2)18-21-7-5-19(6-8-21)11-15-23(27)17-24(28)16-12-20-9-13-22(14-10-20)26(3)4/h5-16H,17-18H2,1-4H3/b15-11+,16-12+
Standard InChI Key: NXFAPWYSRNCCLI-JOBJLJCHSA-N
Molfile:
RDKit 2D
28 29 0 0 0 0 0 0 0 0999 V2000
3.6331 -3.6060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5548 -3.6021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6003 1.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8990 0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2003 1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2024 2.6932 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.4990 0.7409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8003 1.4887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8024 2.6887 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-9.0990 0.7364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.4003 1.4841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6990 0.7318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-13.0007 1.4773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.2971 0.7228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.2919 -0.7772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.9903 -1.5227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6938 -0.7682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-15.5875 -1.5348 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-15.5816 -2.7348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-16.6298 -0.9402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 1 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
11 13 1 0
13 14 1 0
14 15 2 0
14 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
21 24 1 0
24 25 1 0
24 26 1 0
8 27 1 0
27 28 2 0
28 5 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 376.50Molecular Weight (Monoisotopic): 376.2151AlogP: 4.07#Rotatable Bonds: 9Polar Surface Area: 40.62Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.76CX Basic pKa: 8.11CX LogP: 4.97CX LogD: 4.29Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.49Np Likeness Score: -0.19
References 1. (2015) Curcumin analogues as zinc chelators and their uses,