US9206167, 89

ID: ALA3907222

PubChem CID: 122172697

Max Phase: Preclinical

Molecular Formula: C26H33N3OS

Molecular Weight: 435.64

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  c1cc(N2CCN(CCCCOCc3ccc4c(c3)CNCC4)CC2)c2ccsc2c1

Standard InChI:  InChI=1S/C26H33N3OS/c1(2-16-30-20-21-6-7-22-8-10-27-19-23(22)18-21)11-28-12-14-29(15-13-28)25-4-3-5-26-24(25)9-17-31-26/h3-7,9,17-18,27H,1-2,8,10-16,19-20H2

Standard InChI Key:  NJLMNCRNUCQQEN-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
    3.8912   -5.2578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1894   -6.0109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1873   -7.5117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4855   -8.2648    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4855   -9.7648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7846  -10.5149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0836   -9.7649    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.0836   -8.2649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7846   -7.5149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3833  -10.5153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6812   -9.7633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9815  -10.5113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9838  -12.0113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6859  -12.7633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3768  -14.2303    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    9.8852  -14.3894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2730  -13.0200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3857  -12.0153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8933   -3.7570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971   -0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  4  1  0
  7 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 10  1  0
 18 14  2  0
  1 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 25  1  0
 30 31  2  0
 31 22  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3907222

    ---

Associated Targets(non-human)

Htr2a Serotonin 2a (5-HT2a) receptor (3540 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 435.64Molecular Weight (Monoisotopic): 435.2344AlogP: 4.67#Rotatable Bonds: 8
Polar Surface Area: 27.74Molecular Species: BASEHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.10CX LogP: 4.66CX LogD: 1.99
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.52Np Likeness Score: -1.37

References

1.  (2015)  Piperazine-substituted benzothiophenes for treatment of mental disorders, 

Source

Source(1):