The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9206167, 89 ID: ALA3907222
PubChem CID: 122172697
Max Phase: Preclinical
Molecular Formula: C26H33N3OS
Molecular Weight: 435.64
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: c1cc(N2CCN(CCCCOCc3ccc4c(c3)CNCC4)CC2)c2ccsc2c1
Standard InChI: InChI=1S/C26H33N3OS/c1(2-16-30-20-21-6-7-22-8-10-27-19-23(22)18-21)11-28-12-14-29(15-13-28)25-4-3-5-26-24(25)9-17-31-26/h3-7,9,17-18,27H,1-2,8,10-16,19-20H2
Standard InChI Key: NJLMNCRNUCQQEN-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 35 0 0 0 0 0 0 0 0999 V2000
3.8912 -5.2578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1894 -6.0109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1873 -7.5117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4855 -8.2648 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4855 -9.7648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7846 -10.5149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0836 -9.7649 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0836 -8.2649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7846 -7.5149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3833 -10.5153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6812 -9.7633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9815 -10.5113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9838 -12.0113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6859 -12.7633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3768 -14.2303 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.8852 -14.3894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2730 -13.0200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3857 -12.0153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 -3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 -0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 4 1 0
7 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 10 1 0
18 14 2 0
1 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 25 1 0
30 31 2 0
31 22 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 435.64Molecular Weight (Monoisotopic): 435.2344AlogP: 4.67#Rotatable Bonds: 8Polar Surface Area: 27.74Molecular Species: BASEHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.10CX LogP: 4.66CX LogD: 1.99Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.52Np Likeness Score: -1.37
References 1. (2015) Piperazine-substituted benzothiophenes for treatment of mental disorders,