The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9181249, 144 ID: ALA3908448
Max Phase: Preclinical
Molecular Formula: C24H29F2N5O3
Molecular Weight: 473.52
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)N1CCc2nc(N3CCC(Oc4ccc(F)cc4F)CC3)c(N[C@H]3C[C@@H](O)C3)nc2C1
Standard InChI: InChI=1S/C24H29F2N5O3/c1-14(32)31-9-6-20-21(13-31)28-23(27-16-11-17(33)12-16)24(29-20)30-7-4-18(5-8-30)34-22-3-2-15(25)10-19(22)26/h2-3,10,16-18,33H,4-9,11-13H2,1H3,(H,27,28)/t16-,17+
Standard InChI Key: HRCVXNPXGOAGEG-CALCHBBNSA-N
Molfile:
RDKit 2D
34 38 0 0 1 0 0 0 0 0999 V2000
3.6375 -0.9049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5956 -2.7031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1968 1.5003 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.1993 3.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4995 3.7483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7974 2.9963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7950 1.4963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4948 0.7483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0999 3.7419 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-10.3974 2.9876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3898 1.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6851 0.7310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.9879 1.4744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.0241 0.8692 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-12.9955 2.9744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.7002 3.7310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.7063 4.9309 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1953 -1.5031 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.1932 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2503 -4.0166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1859 -5.0736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1817 -6.2736 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.1290 -4.0092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 10 1 0
13 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
20 22 1 0
22 23 2 0
23 17 1 0
23 24 1 0
9 25 2 0
25 26 1 0
27 26 1 1
27 28 1 0
28 29 1 0
29 30 1 1
29 31 1 0
31 27 1 0
25 32 1 0
32 33 2 0
33 7 1 0
33 34 1 0
34 4 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 473.52Molecular Weight (Monoisotopic): 473.2238AlogP: 2.64#Rotatable Bonds: 5Polar Surface Area: 90.82Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 1.40CX LogP: 0.94CX LogD: 0.94Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.69Np Likeness Score: -0.89
References 1. (2015) Substituted pyrido[3,4-b]pyrazines as GPR6 modulators, 2. (2018) Tetrahydropyridopyrazines modulators of gpr6, 3. (2016) Tetrahydropyridopyrazines modulators of gpr6,