The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9394303, 61 ID: ALA3908553
PubChem CID: 129012571
Max Phase: Preclinical
Molecular Formula: C25H19N3O3S
Molecular Weight: 441.51
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nn(Cc2ccc(Oc3ccccc3)cc2)c2nc(-c3cccs3)cc(C(=O)O)c12
Standard InChI: InChI=1S/C25H19N3O3S/c1-16-23-20(25(29)30)14-21(22-8-5-13-32-22)26-24(23)28(27-16)15-17-9-11-19(12-10-17)31-18-6-3-2-4-7-18/h2-14H,15H2,1H3,(H,29,30)
Standard InChI Key: AOKJSDQDESVTNU-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
-0.4916 -3.8582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3114 -2.9665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8032 -3.1233 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4133 -1.7530 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8794 -1.4442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8823 -2.5608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3506 -2.2538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3506 -3.3718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8824 -4.7969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8807 -5.9175 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4102 -7.3427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4064 -8.4642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9332 -9.8877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4640 -10.1897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4678 -9.0682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9409 -7.6448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4142 -5.1039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4142 -3.9859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6003 -1.4978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6387 -0.8963 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6024 -2.6978 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2121 3.8625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7463 5.2884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7537 5.2860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2149 3.8587 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
9 17 1 0
17 18 2 0
18 6 1 0
4 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 1 0
24 25 2 0
24 26 1 0
23 27 2 0
27 2 1 0
27 19 1 0
21 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 28 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 441.51Molecular Weight (Monoisotopic): 441.1147AlogP: 6.01#Rotatable Bonds: 6Polar Surface Area: 77.24Molecular Species: ACIDHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.52CX Basic pKa: 1.81CX LogP: 5.25CX LogD: 2.02Aromatic Rings: 5Heavy Atoms: 32QED Weighted: 0.35Np Likeness Score: -1.72
References 1. (2016) Small molecule inhibitors of MCL-1 and uses thereof,