The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((4,6-dimethyl-2-oxo-1,2-dihydropyridin-3-yl)methyl)-3-methyl-6-(2-(piperazin-1-yl)pyrimidin-5-yl)-1-(tetrahydro-2H-pyran-4-yl)indoline-4-carboxamide ID: ALA3909213
PubChem CID: 134131668
Max Phase: Preclinical
Molecular Formula: C31H39N7O3
Molecular Weight: 557.70
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(C)c(CNC(=O)c2cc(-c3cnc(N4CCNCC4)nc3)cc3c2C(C)CN3C2CCOCC2)c(=O)[nH]1
Standard InChI: InChI=1S/C31H39N7O3/c1-19-12-21(3)36-30(40)26(19)17-33-29(39)25-13-22(23-15-34-31(35-16-23)37-8-6-32-7-9-37)14-27-28(25)20(2)18-38(27)24-4-10-41-11-5-24/h12-16,20,24,32H,4-11,17-18H2,1-3H3,(H,33,39)(H,36,40)
Standard InChI Key: YPAORUYRBZFOFV-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 46 0 0 0 0 0 0 0 0999 V2000
14.1556 -12.9675 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.6386 -12.3104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1572 -11.6451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3789 -11.8963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6716 -11.4846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9649 -11.8942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9613 -12.7114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6686 -13.1190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3794 -12.7135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6752 -10.6674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9679 -10.2599 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.3861 -10.2620 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.4557 -14.6943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2044 -13.9201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4027 -13.7458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8563 -14.3540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1076 -15.1282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9052 -15.3025 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.8369 -13.9279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5442 -14.3396 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.2509 -13.9341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2545 -13.1169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5472 -12.7052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8364 -13.1107 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1260 -14.3375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4187 -13.9258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7120 -14.3313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7084 -15.1484 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4157 -15.5601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1224 -15.1547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4112 -10.8690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3856 -9.4448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1000 -8.2221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0964 -9.0393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8037 -9.4510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5105 -9.0414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5141 -8.2242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8068 -7.8166 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.3927 -7.8104 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2208 -7.8187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8001 -10.2682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
1 9 1 0
4 9 2 0
10 11 2 0
10 12 1 0
5 10 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
13 18 1 0
1 15 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
19 24 2 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
25 30 1 0
19 25 1 0
7 22 1 0
3 31 1 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
33 38 1 0
33 39 2 0
37 40 1 0
35 41 1 0
32 34 1 0
12 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 557.70Molecular Weight (Monoisotopic): 557.3114AlogP: 2.89#Rotatable Bonds: 6Polar Surface Area: 115.48Molecular Species: BASEHBA: 8HBD: 3#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.64CX Basic pKa: 8.69CX LogP: 1.59CX LogD: 0.28Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.42Np Likeness Score: -1.03
References 1. Ansari A, Satalkar S, Patil V, Shete AS, Kaur S, Gupta A, Singh S, Raja M, Severance DL, Bernales S, Chakravarty S, Hung DT, Pham SM, Herrera FJ, Rai R.. (2017) Novel 3-methylindoline inhibitors of EZH2: Design, synthesis and SAR., 27 (2): [PMID:27923618 ] [10.1016/j.bmcl.2016.11.080 ] 2. Ansari A, Satalkar S, Patil V, Shete AS, Kaur S, Gupta A, Singh S, Raja M, Severance DL, Bernales S, Chakravarty S, Hung DT, Pham SM, Herrera FJ, Rai R.. (2017) Novel 3-methylindoline inhibitors of EZH2: Design, synthesis and SAR., 27 (2): [PMID:27923618 ] [10.1016/j.bmcl.2016.11.080 ]