The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9156810, (62, 63) ID: ALA3909714
PubChem CID: 9983881
Max Phase: Preclinical
Molecular Formula: C30H41NO4S
Molecular Weight: 511.73
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)C(=O)CCC/C=C\C[C@H]1C(=O)C(C)(C)[C@@H](O)[C@@H]1/C=C/C(O)Cc1cc2ccccc2s1
Standard InChI: InChI=1S/C30H41NO4S/c1-5-31(6-2)27(33)16-10-8-7-9-14-24-25(29(35)30(3,4)28(24)34)18-17-22(32)20-23-19-21-13-11-12-15-26(21)36-23/h7,9,11-13,15,17-19,22,24-25,29,32,35H,5-6,8,10,14,16,20H2,1-4H3/b9-7-,18-17+/t22?,24-,25-,29+/m1/s1
Standard InChI Key: YEMANPZYEQIDPU-NBFZGHLFSA-N
Molfile:
RDKit 2D
36 38 0 0 1 0 0 0 0 0999 V2000
16.0647 -5.6111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8893 -5.3689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8914 -6.4899 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.3665 -7.9135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5421 -8.1544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4214 -6.1870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0438 -5.0480 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4234 -7.3080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9535 -7.0051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9555 -8.1261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4856 -7.8232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4876 -8.9441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9585 -10.3692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9623 -11.4882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2706 -12.9432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6497 -13.5353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8526 -12.6379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2317 -13.2300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3726 -14.4217 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4346 -12.3325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8113 -12.9237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1018 -12.1591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2270 -13.1499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7169 -12.9764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6122 -14.1800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0175 -15.5570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5275 -15.7306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6323 -14.5270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1396 -14.3873 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.0002 -13.7164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8953 -14.9118 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8742 -12.7253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5335 -13.8759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0745 -11.8307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4689 -11.3482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8572 -10.3158 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
3 6 1 0
6 7 2 0
6 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
14 13 1 6
14 15 1 0
15 16 1 1
16 17 2 0
17 18 1 0
18 19 1 0
18 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
28 29 1 0
29 21 1 0
15 30 1 0
30 31 1 6
30 32 1 0
32 33 1 0
32 34 1 0
32 35 1 0
35 14 1 0
35 36 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 511.73Molecular Weight (Monoisotopic): 511.2756AlogP: 5.55#Rotatable Bonds: 12Polar Surface Area: 77.84Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.49CX LogD: 5.49Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.29Np Likeness Score: 0.42
References 1. (2015) Treatment of inflammatory bowel disease,