The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Hexyl (amino(4-((8-(1-(pyrrolidine-1-carbonyl)cyclopentyl)-1,2,3,4-tetrahydrobenzo[4,5]imidazo[1,2-a]pyrazin-1-yl)methyl)phenyl)methylene)carbamate ID: ALA3909953
Max Phase: Preclinical
Molecular Formula: C35H46N6O3
Molecular Weight: 598.79
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCOC(=O)/N=C(\N)c1ccc(CC2NCCn3c2nc2cc(C4(C(=O)N5CCCC5)CCCC4)ccc23)cc1
Standard InChI: InChI=1S/C35H46N6O3/c1-2-3-4-9-22-44-34(43)39-31(36)26-12-10-25(11-13-26)23-29-32-38-28-24-27(14-15-30(28)41(32)21-18-37-29)35(16-5-6-17-35)33(42)40-19-7-8-20-40/h10-15,24,29,37H,2-9,16-23H2,1H3,(H2,36,39,43)
Standard InChI Key: VFJJVYVHWTWNPY-UHFFFAOYSA-N
Molfile:
RDKit 2D
44 49 0 0 0 0 0 0 0 0999 V2000
15.4754 -10.4239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6515 -10.4671 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.9247 -11.1158 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.8498 -9.6888 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.2769 -11.2021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4520 -11.2021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0395 -11.9166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2145 -11.9166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8020 -11.2021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2145 -10.4877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0395 -10.4877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9770 -11.2021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7395 -10.4877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5646 -10.4877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3270 -9.7732 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.9770 -9.7732 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5646 -9.0588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7395 -9.0588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1875 -11.1007 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4339 -10.7652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5201 -9.9448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8527 -9.4599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0990 -9.7954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0128 -10.6158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6802 -11.1007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2590 -10.9514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4521 -11.1229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3659 -11.9434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1195 -12.2790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6716 -11.6658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0042 -10.1668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5233 -9.5257 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1893 -10.0377 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6059 -10.6211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8709 -10.2466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9999 -9.4317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8147 -9.3027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6895 -11.9166 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.6737 -9.6457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1231 -10.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9470 -10.2944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3962 -10.9862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2201 -10.9430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6694 -11.6350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 2 0
1 4 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
6 11 2 0
13 14 1 0
13 15 1 0
14 16 1 0
16 17 1 0
17 18 1 0
15 18 1 0
19 20 1 0
20 21 1 0
22 23 1 0
23 24 2 0
24 25 1 0
20 25 2 0
21 22 2 0
15 21 1 0
13 19 2 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
26 30 1 0
31 32 2 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
33 37 1 0
31 33 1 0
26 31 1 0
24 26 1 0
12 14 1 0
9 12 1 0
5 6 1 0
5 38 1 0
2 5 2 0
39 40 1 0
40 41 1 0
41 42 1 0
42 43 1 0
43 44 1 0
4 39 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 598.79Molecular Weight (Monoisotopic): 598.3631AlogP: 5.78#Rotatable Bonds: 10Polar Surface Area: 114.84Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 7.55CX LogP: 5.67CX LogD: 5.29Aromatic Rings: 3Heavy Atoms: 44QED Weighted: 0.17Np Likeness Score: -0.52
References 1. Chen D, Shi J, Liu J, Zhang X, Deng X, Yang Y, Cui S, Zhu Q, Gong G, Xu Y.. (2017) Design, synthesis and antithrombotic evaluation of novel non-peptide thrombin inhibitors., 25 (2): [PMID:27884512 ] [10.1016/j.bmc.2016.11.012 ]