The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-((5-tert-butyl-1H-imidazol-4-yl)methylene)-6-(3,4,5-trimethoxybenzylidene)piperazine-2,5-dione ID: ALA3911250
PubChem CID: 58649699
Max Phase: Preclinical
Molecular Formula: C22H26N4O5
Molecular Weight: 426.47
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(/C=c2\[nH]c(=O)/c(=C/c3nc[nH]c3C(C)(C)C)[nH]c2=O)cc(OC)c1OC
Standard InChI: InChI=1S/C22H26N4O5/c1-22(2,3)19-13(23-11-24-19)10-15-21(28)25-14(20(27)26-15)7-12-8-16(29-4)18(31-6)17(9-12)30-5/h7-11H,1-6H3,(H,23,24)(H,25,28)(H,26,27)/b14-7-,15-10-
Standard InChI Key: XKSCQLNKHCLVMJ-WVVHVAJVSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
26.0916 -8.4833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0916 -9.3083 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.8037 -9.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5157 -9.3083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5157 -8.4833 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.8037 -8.0666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8037 -7.2416 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.8037 -10.5417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.2296 -9.7219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9446 -9.3104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6957 -9.6436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2486 -9.0313 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.8371 -8.3162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0299 -8.4867 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.8672 -10.4506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2541 -11.0026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6518 -10.7056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0792 -11.2458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3759 -8.0729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6627 -8.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9476 -8.0740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2348 -8.4878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2368 -9.3137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9575 -9.7239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6673 -9.3077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5193 -8.0771 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.8059 -8.4914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9629 -10.5489 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.2510 -10.9661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5241 -9.7293 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.8079 -9.3198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
3 8 2 0
4 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 1 0
13 14 2 0
14 10 1 0
11 15 1 0
15 16 1 0
15 17 1 0
15 18 1 0
1 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
22 26 1 0
26 27 1 0
24 28 1 0
28 29 1 0
23 30 1 0
30 31 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 426.47Molecular Weight (Monoisotopic): 426.1903AlogP: 0.77#Rotatable Bonds: 5Polar Surface Area: 122.09Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.05CX Basic pKa: 6.23CX LogP: 1.33CX LogD: 1.19Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.55Np Likeness Score: 0.35
References 1. (2007) Analogs of dehydrophenylahistins and their therapeutic use,