The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-N-(1-morpholinopropan-2-yl)-6-(8-(pyridin-4-yl)-1H-imidazo[4,5-c][1,7]naphthyridin-1-yl)quinolin-2-amine ID: ALA3912476
PubChem CID: 132587462
Max Phase: Preclinical
Molecular Formula: C30H28N8O
Molecular Weight: 516.61
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@H](CN1CCOCC1)Nc1ccc2cc(-n3cnc4cnc5cnc(-c6ccncc6)cc5c43)ccc2n1
Standard InChI: InChI=1S/C30H28N8O/c1-20(18-37-10-12-39-13-11-37)35-29-5-2-22-14-23(3-4-25(22)36-29)38-19-34-28-17-33-27-16-32-26(15-24(27)30(28)38)21-6-8-31-9-7-21/h2-9,14-17,19-20H,10-13,18H2,1H3,(H,35,36)/t20-/m1/s1
Standard InChI Key: ZMWQOLGHIDQXCJ-HXUWFJFHSA-N
Molfile:
RDKit 2D
39 45 0 0 0 0 0 0 0 0999 V2000
4.8668 -6.7040 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6269 -7.4884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8338 -7.6746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2764 -7.0762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5121 -6.2959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9547 -5.6975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1904 -4.9172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9876 -4.7310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5450 -5.3253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3093 -6.1097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1889 -8.0824 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7564 -1.8817 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0554 -2.3070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0714 -3.1240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7883 -3.5156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4850 -3.0944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2019 -3.4902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9028 -3.0649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8827 -2.2479 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1700 -1.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4691 -2.2775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8212 -4.4227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4730 -3.6814 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6330 -4.3188 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3483 -4.6734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6315 -4.2776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6155 -3.4607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3164 -3.0395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0333 -3.4353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0493 -4.2522 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6047 -8.1138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9033 -7.6907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9242 -6.8731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7556 -6.9359 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0543 -6.5127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3360 -6.9058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3190 -7.7221 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0204 -8.1453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7348 -7.7535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
1 10 1 0
5 10 1 0
2 11 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
12 21 1 0
16 21 1 0
22 23 2 0
22 24 1 0
14 23 1 0
15 24 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
25 30 2 0
18 27 1 0
7 24 1 0
31 32 1 0
32 33 1 6
34 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
34 39 1 0
31 37 1 0
11 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 516.61Molecular Weight (Monoisotopic): 516.2386AlogP: 4.71#Rotatable Bonds: 6Polar Surface Area: 93.88Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 6.99CX LogP: 3.34CX LogD: 3.19Aromatic Rings: 6Heavy Atoms: 39QED Weighted: 0.34Np Likeness Score: -1.41
References 1. Glatthar R, Stojanovic A, Troxler T, Mattes H, Möbitz H, Beerli R, Blanz J, Gassmann E, Drückes P, Fendrich G, Gutmann S, Martiny-Baron G, Spence F, Hornfeld J, Peel JE, Sparrer H.. (2016) Discovery of Imidazoquinolines as a Novel Class of Potent, Selective, and in Vivo Efficacious Cancer Osaka Thyroid (COT) Kinase Inhibitors., 59 (16): [PMID:27502541 ] [10.1021/acs.jmedchem.6b00598 ]