The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9320734, 415 ID: ALA3912759
PubChem CID: 3268165
Max Phase: Preclinical
Molecular Formula: C17H19N5O7S2
Molecular Weight: 469.50
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(NS(=O)(=O)c2ccc(NS(=O)(=O)c3c(C)noc3C)cc2)nc(OC)n1
Standard InChI: InChI=1S/C17H19N5O7S2/c1-10-16(11(2)29-20-10)31(25,26)21-12-5-7-13(8-6-12)30(23,24)22-14-9-15(27-3)19-17(18-14)28-4/h5-9,21H,1-4H3,(H,18,19,22)
Standard InChI Key: SSDWSTAYENJABB-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
2.5956 -2.7031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 3.0008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3039 3.7494 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.3421 3.1476 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3020 2.5494 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3070 5.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6076 5.9975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6107 7.4975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3132 8.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3132 9.7510 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0139 10.5023 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.0255 9.9026 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0134 9.3023 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0139 12.0031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2275 12.8628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3665 12.4852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7640 14.2894 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7360 14.2894 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1996 12.8628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3386 12.4852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0126 7.5029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0095 6.0029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5972 -1.5031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5955 -2.7031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 2 0
7 9 2 0
7 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 1 0
15 16 2 0
15 17 2 0
15 18 1 0
18 19 2 0
19 20 1 0
19 21 1 0
21 22 1 0
22 23 2 0
23 18 1 0
23 24 1 0
13 25 1 0
25 26 2 0
26 10 1 0
5 27 2 0
27 28 1 0
28 29 1 0
29 30 1 0
28 31 2 0
31 3 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 469.50Molecular Weight (Monoisotopic): 469.0726AlogP: 1.70#Rotatable Bonds: 8Polar Surface Area: 162.61Molecular Species: ACIDHBA: 10HBD: 2#RO5 Violations: ┄HBA (Lipinski): 12HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 5.92CX Basic pKa: 1.09CX LogP: 1.27CX LogD: -0.30Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.50Np Likeness Score: -1.96
References 1. (2016) Small molecule inhibitors of the pleckstrin homology domain and methods for using same, 2. (2017) Inhibitors of grb2-associated binding protein 1 (gab1) and methods of treating cancer using the same,