The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Picraquassin B; (20S,21R,23R)-21-ethoxy-3alpha,7alpha-dihydroxy-21,23-epoxyapotirucalla-14,24-diene ID: ALA3913105
PubChem CID: 134143015
Max Phase: Preclinical
Molecular Formula: C32H52O4
Molecular Weight: 500.76
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCO[C@@H]1O[C@@H](C=C(C)C)C[C@H]1[C@@H]1CC=C2[C@]3(C)[C@H](O)C[C@H]4C(C)(C)[C@H](O)CC[C@]4(C)[C@H]3CC[C@]21C
Standard InChI: InChI=1S/C32H52O4/c1-9-35-28-21(17-20(36-28)16-19(2)3)22-10-11-23-30(22,6)14-12-24-31(7)15-13-26(33)29(4,5)25(31)18-27(34)32(23,24)8/h11,16,20-22,24-28,33-34H,9-10,12-15,17-18H2,1-8H3/t20-,21-,22-,24+,25-,26+,27+,28+,30-,31+,32-/m0/s1
Standard InChI Key: LYLVEWXHFLDBNU-YSGDIKDGSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
14.2100 -1.4321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9178 -1.0236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4841 -0.9576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5764 -6.6820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1719 -5.9762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7629 -6.6794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4703 -4.7546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4703 -5.5718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1756 -4.3418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8808 -4.7546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8819 -5.5718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5862 -5.9772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2940 -5.5700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5841 -4.3428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2949 -4.7534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2936 -3.1146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5804 -3.5243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0044 -3.5252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0013 -4.3469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7817 -4.6037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2672 -3.9408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7867 -3.2744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0400 -2.5023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8181 -2.2527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8211 -1.4355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0448 -1.1800 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5622 -1.8394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7627 -5.9806 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8735 -3.9374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2892 -3.9332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7450 -1.8364 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.9991 -2.7075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0012 -5.9795 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5793 -5.1590 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
8.8777 -6.3848 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
12.5715 -3.4834 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
12.3696 -1.7051 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
10.3338 -2.5426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5166 -2.5396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1875 -2.2490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 2 0
5 4 1 0
6 5 1 0
7 8 1 0
7 9 1 0
8 5 1 0
5 11 1 0
10 9 1 0
10 11 1 0
10 14 1 0
11 12 1 0
12 13 1 0
13 15 1 0
14 15 1 0
14 17 1 0
15 19 1 0
18 16 1 0
16 17 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 1 0
22 18 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 23 1 0
22 23 1 0
8 28 1 6
10 29 1 1
15 30 1 1
27 31 1 6
18 32 1 6
13 33 1 6
14 34 1 6
11 35 1 6
22 36 1 1
23 37 1 6
31 38 1 0
38 39 1 0
25 3 1 1
1 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 500.76Molecular Weight (Monoisotopic): 500.3866AlogP: 6.66#Rotatable Bonds: 4Polar Surface Area: 58.92Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.61CX LogD: 5.61Aromatic Rings: ┄Heavy Atoms: 36QED Weighted: 0.42Np Likeness Score: 3.10
References 1. Xu J, Xiao D, Lin QH, He JF, Liu WY, Xie N, Feng F, Qu W.. (2016) Cytotoxic Tirucallane and Apotirucallane Triterpenoids from the Stems of Picrasma quassioides., 79 (8): [PMID:27494664 ] [10.1021/acs.jnatprod.5b01137 ]