US9340574, 3

ID: ALA3917014

PubChem CID: 77139523

Max Phase: Preclinical

Molecular Formula: C24H28F2IN4O7P

Molecular Weight: 680.38

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)NC(Cc1ccc(C(F)(F)P(=O)(O)O)cc1)C(=O)NC(CCCNC(=O)c1cccc(I)c1)C(N)=O

Standard InChI:  InChI=1S/C24H28F2IN4O7P/c1-14(32)30-20(12-15-7-9-17(10-8-15)24(25,26)39(36,37)38)23(35)31-19(21(28)33)6-3-11-29-22(34)16-4-2-5-18(27)13-16/h2,4-5,7-10,13,19-20H,3,6,11-12H2,1H3,(H2,28,33)(H,29,34)(H,30,32)(H,31,35)(H2,36,37,38)

Standard InChI Key:  DSHZHFAULLMSCZ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 39 40  0  0  0  0  0  0  0  0999 V2000
   -0.0007   -1.7949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0048   -2.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0464   -3.5909    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2925   -3.7494    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5988    1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6378    0.9001    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5986    0.3004    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5998    3.0012    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6390    3.6012    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5607    3.6016    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6000    4.2012    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8933   -3.7570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9336   -3.1588    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8912   -5.2578    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1894   -6.0109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1873   -7.5117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4855   -8.2648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4833   -9.7656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7815  -10.5187    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7794  -12.0195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7391  -12.6177    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0776  -12.7726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0777  -14.2726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3767  -15.0227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6758  -14.2727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6758  -12.7727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7150  -12.1727    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0
   10.3768  -12.0227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4920   -5.2654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5293   -5.8687    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4962   -4.0654    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
 10 13  1  0
 13 14  1  0
 13 15  1  0
 13 16  1  0
 16 17  2  0
 16 18  1  0
 16 19  1  0
  5 20  1  0
 20 21  2  0
 20 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  2  0
 28 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  1  0
 34 36  2  0
 36 30  1  0
 23 37  1  0
 37 38  2  0
 37 39  1  0
M  END

Associated Targets(Human)

PTPN9 Tchem Tyrosine-protein phosphatase non-receptor type 9 (97 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PTPN1 Tchem Protein-tyrosine phosphatase 1B (8528 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 680.38Molecular Weight (Monoisotopic): 680.0708AlogP: 1.75#Rotatable Bonds: 13
Polar Surface Area: 187.92Molecular Species: ACIDHBA: 5HBD: 6
#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 7#RO5 Violations (Lipinski): 3
CX Acidic pKa: 0.49CX Basic pKa: CX LogP: 0.69CX LogD: -1.88
Aromatic Rings: 2Heavy Atoms: 39QED Weighted: 0.11Np Likeness Score: -0.65

References

1.  (2016)  Inhibitors of protein tyrosine phosphatases, 

Source

Source(1):