The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9340574, 3 ID: ALA3917014
PubChem CID: 77139523
Max Phase: Preclinical
Molecular Formula: C24H28F2IN4O7P
Molecular Weight: 680.38
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)NC(Cc1ccc(C(F)(F)P(=O)(O)O)cc1)C(=O)NC(CCCNC(=O)c1cccc(I)c1)C(N)=O
Standard InChI: InChI=1S/C24H28F2IN4O7P/c1-14(32)30-20(12-15-7-9-17(10-8-15)24(25,26)39(36,37)38)23(35)31-19(21(28)33)6-3-11-29-22(34)16-4-2-5-18(27)13-16/h2,4-5,7-10,13,19-20H,3,6,11-12H2,1H3,(H2,28,33)(H,29,34)(H,30,32)(H,31,35)(H2,36,37,38)
Standard InChI Key: DSHZHFAULLMSCZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 40 0 0 0 0 0 0 0 0999 V2000
-0.0007 -1.7949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0048 -2.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0464 -3.5909 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2925 -3.7494 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5988 1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6378 0.9001 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.5986 0.3004 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.5998 3.0012 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
-3.6390 3.6012 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.5607 3.6016 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6000 4.2012 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 -3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9336 -3.1588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8912 -5.2578 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1894 -6.0109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1873 -7.5117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4855 -8.2648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4833 -9.7656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7815 -10.5187 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7794 -12.0195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7391 -12.6177 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0776 -12.7726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0777 -14.2726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3767 -15.0227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6758 -14.2727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6758 -12.7727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7150 -12.1727 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
10.3768 -12.0227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4920 -5.2654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5293 -5.8687 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4962 -4.0654 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
10 13 1 0
13 14 1 0
13 15 1 0
13 16 1 0
16 17 2 0
16 18 1 0
16 19 1 0
5 20 1 0
20 21 2 0
20 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 2 0
28 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 1 0
34 36 2 0
36 30 1 0
23 37 1 0
37 38 2 0
37 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 680.38Molecular Weight (Monoisotopic): 680.0708AlogP: 1.75#Rotatable Bonds: 13Polar Surface Area: 187.92Molecular Species: ACIDHBA: 5HBD: 6#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 7#RO5 Violations (Lipinski): 3CX Acidic pKa: 0.49CX Basic pKa: ┄CX LogP: 0.69CX LogD: -1.88Aromatic Rings: 2Heavy Atoms: 39QED Weighted: 0.11Np Likeness Score: -0.65
References 1. (2016) Inhibitors of protein tyrosine phosphatases,