The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-{4-[(2-Amino-4-oxo-3,4-dihydro-pyrido[2,3-d]pyrimidin-6-ylmethyl)-amino]-benzoylamino}-4-sulfo-butyric acid ID: ALA39175
PubChem CID: 135887105
Max Phase: Preclinical
Molecular Formula: C19H20N6O7S
Molecular Weight: 476.47
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Nc1nc(O)c2cc(CNc3ccc(C(=O)NC(CCS(=O)(=O)O)C(=O)O)cc3)cnc2n1
Standard InChI: InChI=1S/C19H20N6O7S/c20-19-24-15-13(17(27)25-19)7-10(9-22-15)8-21-12-3-1-11(2-4-12)16(26)23-14(18(28)29)5-6-33(30,31)32/h1-4,7,9,14,21H,5-6,8H2,(H,23,26)(H,28,29)(H,30,31,32)(H3,20,22,24,25,27)
Standard InChI Key: DEZOURQTRLKTPD-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
-2.8833 -2.7375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.4000 -1.8292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3625 -2.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8833 -1.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3625 -1.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4000 -2.4375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3792 -0.8792 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.7792 -0.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8458 -2.7292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3042 -0.9000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8167 0.0083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8167 -0.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8458 -1.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1542 -1.4375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6042 -0.3250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2625 -0.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8875 -0.9292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3417 -0.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8542 -0.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7750 -0.0042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3250 -1.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3292 0.3083 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9208 -2.7375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.2833 -1.8167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.9625 -1.0292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3208 -2.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2667 -1.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7375 -0.6125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2292 -1.5125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8083 -1.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2917 0.3000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2250 -0.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7500 -1.8125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 6 2 0
3 1 2 0
4 2 1 0
5 3 1 0
6 1 1 0
7 19 1 0
8 16 1 0
9 3 1 0
10 8 1 0
11 12 1 0
12 10 1 0
13 5 1 0
14 7 2 0
15 7 2 0
16 27 2 0
17 4 1 0
18 12 1 0
19 18 1 0
20 8 2 0
21 26 1 0
22 11 2 0
23 6 1 0
24 30 1 0
25 7 1 0
26 9 2 0
27 33 1 0
28 32 2 0
29 24 1 0
30 21 1 0
31 11 1 0
32 29 1 0
33 29 2 0
4 5 2 0
13 21 2 0
16 28 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 476.47Molecular Weight (Monoisotopic): 476.1114AlogP: 0.39#Rotatable Bonds: 9Polar Surface Area: 217.72Molecular Species: ACIDHBA: 10HBD: 6#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 7#RO5 Violations (Lipinski): 2CX Acidic pKa: -1.06CX Basic pKa: 3.55CX LogP: -0.87CX LogD: -6.11Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.23Np Likeness Score: -0.68
References 1. Rosowsky A, Forsch RA, Reich VE, Freisheim JH, Moran RG.. (1992) Side chain modified 5-deazafolate and 5-deazatetrahydrofolate analogues as mammalian folylpolyglutamate synthetase and glycinamide ribonucleotide formyltransferase inhibitors: synthesis and in vitro biological evaluation., 35 (9): [PMID:1578484 ] [10.1021/jm00087a012 ]