The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-4-fluoro-N-(4-(1-(8-methyl-2-(methylamino)quinazolin-4-ylamino)ethyl)phenyl)benzamide ID: ALA3919330
PubChem CID: 68941228
Max Phase: Preclinical
Molecular Formula: C25H24FN5O
Molecular Weight: 429.50
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CNc1nc(N[C@H](C)c2ccc(NC(=O)c3ccc(F)cc3)cc2)c2cccc(C)c2n1
Standard InChI: InChI=1S/C25H24FN5O/c1-15-5-4-6-21-22(15)30-25(27-3)31-23(21)28-16(2)17-9-13-20(14-10-17)29-24(32)18-7-11-19(26)12-8-18/h4-14,16H,1-3H3,(H,29,32)(H2,27,28,30,31)/t16-/m1/s1
Standard InChI Key: LBWYBHYHBIMHKK-MRXNPFEDSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
39.1189 -12.0721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4057 -12.4807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4057 -13.3021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6966 -13.7148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9834 -13.3021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9834 -12.4807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6966 -12.0721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1189 -11.2508 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.8321 -12.4807 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.5453 -12.0721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5453 -11.2508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.2503 -10.8381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9635 -11.2508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9635 -12.0721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.2503 -12.4807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6726 -10.8381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6726 -10.0168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3858 -11.2508 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.3858 -13.7148 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.6726 -13.3021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6726 -12.4807 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.3858 -12.0721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.0990 -12.4807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.8081 -12.0721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.5213 -12.4807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.5213 -13.3021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.8081 -13.7148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.0990 -13.3021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9635 -13.7148 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.9635 -14.5361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.8081 -14.5361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2701 -13.7148 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
2 7 2 0
1 8 2 0
1 9 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
10 15 2 0
16 17 1 1
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
19 28 2 0
23 28 1 0
29 30 1 0
20 29 1 0
27 31 1 0
18 22 1 0
16 18 1 0
13 16 1 0
9 10 1 0
5 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 429.50Molecular Weight (Monoisotopic): 429.1965AlogP: 5.54#Rotatable Bonds: 6Polar Surface Area: 78.94Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 6.68CX LogP: 5.53CX LogD: 5.46Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.37Np Likeness Score: -1.62
References 1. (2009) Amino-substituted quinazoline derivatives as inhibitors of Beta-catenin/TCF-4 pathway and cancer treatment agents,