US9253997, 101

ID: ALA3919534

PubChem CID: 53374569

Max Phase: Preclinical

Molecular Formula: C12H15N3O6

Molecular Weight: 297.27

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(NC(=O)NC[C@H](N)C(=O)O)cc(C(=O)O)c1

Standard InChI:  InChI=1S/C12H15N3O6/c1-21-8-3-6(10(16)17)2-7(4-8)15-12(20)14-5-9(13)11(18)19/h2-4,9H,5,13H2,1H3,(H,16,17)(H,18,19)(H2,14,15,20)/t9-/m0/s1

Standard InChI Key:  ZXWDSDYGAMJEJC-VIFPVBQESA-N

Molfile:  

     RDKit          2D

 21 21  0  0  1  0  0  0  0  0999 V2000
    2.5956   -2.7031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0031    3.0008    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3039    3.7494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3421    3.1476    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3070    5.2502    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6078    5.9988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6109    7.4996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5728    8.1014    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9118    8.2481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9142    9.4481    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9499    7.6463    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5972   -1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5955   -2.7031    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6375   -0.9049    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  7  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  1
 11 13  1  0
 13 14  2  0
 13 15  1  0
  5 16  2  0
 16 17  1  0
 17 18  2  0
 18  3  1  0
 17 19  1  0
 19 20  2  0
 19 21  1  0
M  END

Associated Targets(Human)

CASR Tclin Calcium sensing receptor (766 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 297.27Molecular Weight (Monoisotopic): 297.0961AlogP: -0.07#Rotatable Bonds: 6
Polar Surface Area: 150.98Molecular Species: ZWITTERIONHBA: 5HBD: 5
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 6#RO5 Violations (Lipinski): 1
CX Acidic pKa: 1.26CX Basic pKa: 8.50CX LogP: -2.83CX LogD: -6.11
Aromatic Rings: 1Heavy Atoms: 21QED Weighted: 0.49Np Likeness Score: -0.72

References

1.  (2016)  Alkylamine derivative, 

Source

Source(1):