The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9238658, 7 ID: ALA3919582
PubChem CID: 89612771
Max Phase: Preclinical
Molecular Formula: C23H23FN4O3
Molecular Weight: 422.46
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCc1nc2ccc(NC(=O)N3CCC(c4noc5ccc(F)cc45)CC3)cc2o1
Standard InChI: InChI=1S/C23H23FN4O3/c1-2-3-21-26-18-6-5-16(13-20(18)30-21)25-23(29)28-10-8-14(9-11-28)22-17-12-15(24)4-7-19(17)31-27-22/h4-7,12-14H,2-3,8-11H2,1H3,(H,25,29)
Standard InChI Key: ZVWKGLGQTXILAQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 35 0 0 0 0 0 0 0 0999 V2000
2.3952 -6.7615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7974 -5.7210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5497 -4.4224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8032 -3.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4133 -1.7530 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 3.0008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3039 3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3421 3.1476 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3070 5.2502 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6061 6.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6061 7.5003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3071 8.2503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0080 7.5003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0080 6.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3071 9.7511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0924 10.6092 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.5540 12.0365 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.0532 12.0383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0553 13.1544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5230 12.8446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9885 11.4187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1626 11.1708 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.9863 10.3025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5187 10.6124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3114 -2.9665 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 2 0
10 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 12 1 0
15 18 1 0
18 19 2 0
19 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
24 26 1 0
26 27 2 0
27 18 1 0
27 21 1 0
8 28 2 0
28 29 1 0
29 30 2 0
30 6 1 0
30 31 1 0
31 4 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 422.46Molecular Weight (Monoisotopic): 422.1754AlogP: 5.47#Rotatable Bonds: 4Polar Surface Area: 84.40Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.79CX Basic pKa: 0.86CX LogP: 3.87CX LogD: 3.87Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.47Np Likeness Score: -1.99
References 1. (2016) Substituted piperidinyl-carboxamide derivatives useful as SCD 1 inhibitors,