c(DPhe(C5)-Gly-Gly-Gly-Gly-Phe(N2)-NH2)

ID: ALA391991

PubChem CID: 44435742

Max Phase: Preclinical

Molecular Formula: C34H48N8O6

Molecular Weight: 664.81

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  NC(=O)[C@H](Cc1ccccc1)N1CCNCCNC(=O)CCCCCN[C@H](Cc2ccccc2)C(=O)NCC(=O)NCC(=O)NCC1=O

Standard InChI:  InChI=1S/C34H48N8O6/c35-33(47)28(21-26-12-6-2-7-13-26)42-19-18-36-16-17-38-29(43)14-8-3-9-15-37-27(20-25-10-4-1-5-11-25)34(48)41-23-31(45)39-22-30(44)40-24-32(42)46/h1-2,4-7,10-13,27-28,36-37H,3,8-9,14-24H2,(H2,35,47)(H,38,43)(H,39,45)(H,40,44)(H,41,48)/t27-,28+/m1/s1

Standard InChI Key:  ODVCMJHRYJAFIA-IZLXSDGUSA-N

Molfile:  

     RDKit          2D

 48 50  0  0  1  0  0  0  0  0999 V2000
   12.4886  -10.4762    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.2145  -10.8950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2283  -11.7274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4995  -12.1537    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.7846  -13.4206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5050  -12.9945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6593  -12.2005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6593  -13.0269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3410  -13.4289    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6615  -10.5399    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.3429  -14.2554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0641  -14.6691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7982  -14.2471    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.0802   -9.6921    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.3627   -9.2956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6578   -9.7163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7991   -9.2774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5115   -9.6827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9425  -11.7889    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.9505  -10.9575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3029  -10.4271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2067  -12.1487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4869  -10.5989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3936  -11.9309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1720  -11.2094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9395   -9.3106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9317   -8.4856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3490   -8.4707    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.2306   -9.2782    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.9474  -12.1319    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0646  -13.0178    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.5156  -14.6544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5216  -15.4794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2271  -14.2367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9445  -14.6440    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.2211  -13.4117    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.8102  -15.8971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0952  -15.4859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3842  -15.9029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3898  -16.7287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1123  -17.1358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8203  -16.7165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2042  -12.9917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6440   -8.0716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6366   -7.2474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9177   -6.8408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2048   -7.2645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2157   -8.0873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  7  8  1  0
 23 25  1  0
 24 25  1  0
  8  9  1  0
 16 26  1  6
 10 20  1  0
 26 27  1  0
  7 19  1  0
 15 28  2  0
 11 12  1  0
 18 29  2  0
  9 11  1  0
  3 30  2  0
  5 13  1  0
  5 31  2  0
 13 12  1  0
 13 32  1  0
 14 15  1  0
 32 33  1  6
 10 16  1  0
 32 34  1  0
 15 16  1  0
 34 35  1  0
 17 18  1  0
 34 36  2  0
 14 17  1  0
 33 37  1  0
 18  1  1  0
 37 38  2  0
 38 39  1  0
  1  2  1  0
 39 40  2  0
  2  3  1  0
 40 41  1  0
 20 21  1  0
 41 42  2  0
 42 37  1  0
  3  4  1  0
 22 43  2  0
 19 22  1  0
 27 44  2  0
  5  6  1  0
 44 45  1  0
 21 23  1  0
 45 46  2  0
  6  4  1  0
 46 47  1  0
 22 24  1  0
 47 48  2  0
 48 27  1  0
M  END

Associated Targets(Human)

Caco-2 (12174 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Intestine (155 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 664.81Molecular Weight (Monoisotopic): 664.3697AlogP: -1.26#Rotatable Bonds: 6
Polar Surface Area: 203.86Molecular Species: BASEHBA: 8HBD: 7
#RO5 Violations: 2HBA (Lipinski): 14HBD (Lipinski): 8#RO5 Violations (Lipinski): 3
CX Acidic pKa: 12.16CX Basic pKa: 8.87CX LogP: -1.50CX LogD: -3.89
Aromatic Rings: 2Heavy Atoms: 48QED Weighted: 0.20Np Likeness Score: 0.16

References

1. Hess S, Ovadia O, Shalev DE, Senderovich H, Qadri B, Yehezkel T, Salitra Y, Sheynis T, Jelinek R, Gilon C, Hoffman A..  (2007)  Effect of structural and conformation modifications, including backbone cyclization, of hydrophilic hexapeptides on their intestinal permeability and enzymatic stability.,  50  (24): [PMID:17983214] [10.1021/jm070836d]

Source