The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(Z)-4-(3-chloro-4-fluorobenzyl)-6-((4-oxo-2-thioxothiazolidin-5-ylidene)methyl)-2H-benzo[b][1,4]oxazin-3(4H)-one ID: ALA3922359
PubChem CID: 134140359
Max Phase: Preclinical
Molecular Formula: C19H12ClFN2O3S2
Molecular Weight: 434.90
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C1NC(=S)S/C1=C\c1ccc2c(c1)N(Cc1ccc(F)c(Cl)c1)C(=O)CO2
Standard InChI: InChI=1S/C19H12ClFN2O3S2/c20-12-5-11(1-3-13(12)21)8-23-14-6-10(2-4-15(14)26-9-17(23)24)7-16-18(25)22-19(27)28-16/h1-7H,8-9H2,(H,22,25,27)/b16-7-
Standard InChI Key: KWDKVVZOYYHCRG-APSNUPSMSA-N
Molfile:
RDKit 2D
28 31 0 0 0 0 0 0 0 0999 V2000
3.1901 -3.2426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8997 -2.8331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8969 -2.0105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1883 -1.6052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4820 -2.8336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4816 -2.0140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7756 -1.6068 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0654 -2.0147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0658 -2.8343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7764 -3.2460 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3579 -3.2425 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6081 -3.2406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3152 -2.8309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0586 -3.1610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6044 -2.5528 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1947 -1.8457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3957 -2.0170 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.2295 -3.9601 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5258 -1.0986 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.7779 -4.0632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4864 -4.4704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4834 -5.2881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1910 -5.6952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8989 -5.2852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8948 -4.4638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1865 -4.0604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1922 -6.5124 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
4.6080 -5.6916 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
9 11 2 0
2 12 1 0
12 13 2 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 13 1 0
14 18 2 0
16 19 2 0
10 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
23 27 1 0
24 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 434.90Molecular Weight (Monoisotopic): 433.9962AlogP: 3.89#Rotatable Bonds: 3Polar Surface Area: 58.64Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.93CX Basic pKa: ┄CX LogP: 3.86CX LogD: 2.03Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.59Np Likeness Score: -1.99
References 1. Falasca M, Hamilton JR, Selvadurai M, Sundaram K, Adamska A, Thompson PE.. (2017) Class II Phosphoinositide 3-Kinases as Novel Drug Targets., 60 (1): [PMID:27644332 ] [10.1021/acs.jmedchem.6b00963 ]