(E)-3-[4-((Z)-1,2-Diphenyl-but-1-enyl)-phenyl]-N-(3-methoxy-propyl)-acrylamide

ID: ALA39227

PubChem CID: 9910305

Max Phase: Preclinical

Molecular Formula: C29H31NO2

Molecular Weight: 425.57

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC/C(=C(\c1ccccc1)c1ccc(/C=C/C(=O)NCCCOC)cc1)c1ccccc1

Standard InChI:  InChI=1S/C29H31NO2/c1-3-27(24-11-6-4-7-12-24)29(25-13-8-5-9-14-25)26-18-15-23(16-19-26)17-20-28(31)30-21-10-22-32-2/h4-9,11-20H,3,10,21-22H2,1-2H3,(H,30,31)/b20-17+,29-27-

Standard InChI Key:  YCTVEFROKAIABA-JRGHFAHQSA-N

Molfile:  

     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
    3.7542   -3.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4750   -4.3625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4542    0.5833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4542   -0.2417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7542   -3.1292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7417   -0.6542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0417   -4.3667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1875   -3.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7375    0.9958    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0417   -2.7250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4667   -2.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1667    1.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7500   -1.4792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0292   -1.9042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4667   -1.8917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4750   -5.1875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5917    1.0083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0250    1.0125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8792    0.5875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0417   -5.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3292   -3.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9000   -4.3625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1792   -3.1292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3125    0.5958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7417    0.6083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1917   -5.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6167   -4.3750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3292   -5.6125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6125   -3.9417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8875   -2.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6125   -3.1167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6167   -5.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  4  1  0
  4  6  2  0
  5  1  1  0
  6 13  1  0
  7  1  1  0
  8  2  1  0
  9  3  2  0
 10  5  1  0
 11  5  2  0
 12  3  1  0
 13 15  2  0
 14 10  2  0
 15 11  1  0
 16  2  1  0
 17 19  1  0
 18 24  1  0
 19 12  1  0
 20  7  1  0
 21  7  2  0
 22  8  2  0
 23  8  1  0
 24 17  1  0
 25 18  1  0
 26 16  1  0
 27 21  1  0
 28 20  2  0
 29 22  1  0
 30 23  2  0
 31 30  1  0
 32 27  2  0
 13 14  1  0
 28 32  1  0
 31 29  2  0
M  END

Associated Targets(Human)

Ishikawa (877 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 425.57Molecular Weight (Monoisotopic): 425.2355AlogP: 6.22#Rotatable Bonds: 10
Polar Surface Area: 38.33Molecular Species: NEUTRALHBA: 2HBD: 1
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 6.08CX LogD: 6.08
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.24Np Likeness Score: -0.16

References

1. Willson TM, Henke BR, Momtahen TM, Charifson PS, Batchelor KW, Lubahn DB, Moore LB, Oliver BB, Sauls HR, Triantafillou JA..  (1994)  3-[4-(1,2-Diphenylbut-1-enyl)phenyl]acrylic acid: a non-steroidal estrogen with functional selectivity for bone over uterus in rats.,  37  (11): [PMID:8201587] [10.1021/jm00037a002]

Source