N-((3-Fluoro-2'-methyl-[2,4'-bipyridin]-5-yl)methyl)dibenzo[b,d]furan-3-carboxamide

ID: ALA3923788

PubChem CID: 134142008

Max Phase: Preclinical

Molecular Formula: C25H18FN3O2

Molecular Weight: 411.44

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(-c2ncc(CNC(=O)c3ccc4c(c3)oc3ccccc34)cc2F)ccn1

Standard InChI:  InChI=1S/C25H18FN3O2/c1-15-10-17(8-9-27-15)24-21(26)11-16(13-28-24)14-29-25(30)18-6-7-20-19-4-2-3-5-22(19)31-23(20)12-18/h2-13H,14H2,1H3,(H,29,30)

Standard InChI Key:  JMWKQIKOIQORME-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
   12.2673  -13.8931    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.4380  -14.6915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7331  -15.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1266  -14.5563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4569  -13.8090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7331  -15.9172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4380  -16.3258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1471  -15.9172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1471  -15.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9767  -13.1458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1622  -13.2298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8319  -13.9771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3121  -14.6404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8562  -16.3258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8562  -17.1430    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.5612  -15.9172    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.2703  -16.3258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3934  -15.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3934  -15.9172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6843  -16.3258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9793  -15.9172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9793  -15.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6843  -14.6915    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.5165  -14.6915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8074  -15.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0984  -14.6915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0984  -13.8743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8074  -13.4657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5165  -13.8743    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.2256  -15.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0984  -16.3258    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  1  5  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  2  9  2  0
  3  6  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
  4 13  2  0
  5 10  2  0
 14 15  2  0
 14 16  1  0
  8 14  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 18 23  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 24 29  2  0
 18 26  1  0
 24 30  1  0
 19 31  1  0
 17 21  1  0
 16 17  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3923788

    ---

Associated Targets(non-human)

Porcn Probable protein-cysteine N-palmitoyltransferase porcupine (165 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 411.44Molecular Weight (Monoisotopic): 411.1383AlogP: 5.42#Rotatable Bonds: 4
Polar Surface Area: 68.02Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 4.30CX LogP: 3.82CX LogD: 3.82
Aromatic Rings: 5Heavy Atoms: 31QED Weighted: 0.43Np Likeness Score: -1.06

References

1. Xu Z, Xu X, O'Laoi R, Ma H, Zheng J, Chen S, Luo L, Hu Z, He S, Li J, Zhang H, Zhang X..  (2016)  Design, synthesis, and evaluation of novel porcupine inhibitors featuring a fused 3-ring system based on the 'reversed' amide scaffold.,  24  (22): [PMID:27692509] [10.1016/j.bmc.2016.09.041]
2. Ma H, Chen Q, Zhu F, Zheng J, Li J, Zhang H, Chen S, Xing H, Luo L, Zheng LT, He S, Zhang X..  (2018)  Discovery and characterization of a potent Wnt and hedgehog signaling pathways dual inhibitor.,  149  [PMID:29499483] [10.1016/j.ejmech.2018.02.034]

Source