The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-((2-(4-Bromophenyl)-4,5-diphenyl-1H-imidazol-1-yl)methyl)-1H-1,2,3-triazol-1-yl)-N-(4-fluorophenyl)acetamide ID: ALA3924165
PubChem CID: 134140665
Max Phase: Preclinical
Molecular Formula: C32H24BrFN6O
Molecular Weight: 607.49
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Cn1cc(Cn2c(-c3ccc(Br)cc3)nc(-c3ccccc3)c2-c2ccccc2)nn1)Nc1ccc(F)cc1
Standard InChI: InChI=1S/C32H24BrFN6O/c33-25-13-11-24(12-14-25)32-36-30(22-7-3-1-4-8-22)31(23-9-5-2-6-10-23)40(32)20-28-19-39(38-37-28)21-29(41)35-27-17-15-26(34)16-18-27/h1-19H,20-21H2,(H,35,41)
Standard InChI Key: KIFMZQHYPZINPX-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 46 0 0 0 0 0 0 0 0999 V2000
7.6128 -8.7330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4252 -8.6620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1418 -8.0655 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2672 -9.4755 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4506 -9.5465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1063 -10.2893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2914 -10.3576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8212 -9.6844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1685 -8.9474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9853 -8.8778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7708 -7.9236 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3525 -7.1940 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9073 -6.6024 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.6462 -6.9428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5482 -7.7536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3616 -6.5487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0475 -5.2617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8066 -4.4813 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.9760 -4.4769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7244 -5.2406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3789 -5.7317 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9430 -5.4862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3435 -4.9348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5626 -5.1677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3807 -5.9659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9819 -6.5201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7610 -6.2803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5051 -3.8094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8358 -3.0776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3678 -2.4079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5506 -2.4778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2057 -3.2201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6743 -3.8925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8180 -5.5281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9752 -6.3309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7485 -6.5958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3640 -6.0587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2086 -5.2563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4377 -4.9910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1368 -6.3243 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
4.0069 -9.7535 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 2 0
1 4 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
5 10 2 0
4 5 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
11 15 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
17 21 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
22 27 2 0
20 22 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
28 33 2 0
19 28 1 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
34 39 2 0
17 34 1 0
16 21 1 0
14 16 1 0
2 11 1 0
37 40 1 0
8 41 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 607.49Molecular Weight (Monoisotopic): 606.1179AlogP: 7.06#Rotatable Bonds: 8Polar Surface Area: 77.63Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.47CX Basic pKa: 4.45CX LogP: 7.38CX LogD: 7.38Aromatic Rings: 6Heavy Atoms: 41QED Weighted: 0.20Np Likeness Score: -1.76
References 1. Wang G, Peng Z, Wang J, Li J, Li X.. (2016) Synthesis and biological evaluation of novel 2,4,5-triarylimidazole-1,2,3-triazole derivatives via click chemistry as α-glucosidase inhibitors., 26 (23): [PMID:27810241 ] [10.1016/j.bmcl.2016.10.057 ] 2. Dhameja M, Gupta P.. (2019) Synthetic heterocyclic candidates as promising α-glucosidase inhibitors: An overview., 176 [PMID:31112894 ] [10.1016/j.ejmech.2019.04.025 ]