The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9296728, 28 ID: ALA3925166
PubChem CID: 71667835
Max Phase: Preclinical
Molecular Formula: C24H17Cl2NO4
Molecular Weight: 454.31
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)c1cc2ccc(N(Cc3ccc(Cl)cc3)Cc3ccc(Cl)cc3)cc2oc1=O
Standard InChI: InChI=1S/C24H17Cl2NO4/c25-18-6-1-15(2-7-18)13-27(14-16-3-8-19(26)9-4-16)20-10-5-17-11-21(23(28)29)24(30)31-22(17)12-20/h1-12H,13-14H2,(H,28,29)
Standard InChI Key: DBYIZUGYTCROSW-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
2.6024 -2.6977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6387 -0.8963 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2991 3.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -2.7000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8988 3.7486 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.1973 2.9960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1957 1.4952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4925 0.7411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4878 -0.7589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1865 -1.5049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1828 -2.7049 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-3.8898 -0.7509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8944 0.7491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9004 5.2494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6019 6.0020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6012 7.5020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3019 8.2516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0032 7.5011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0363 8.1007 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-0.0037 6.0011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3030 5.2516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
11 12 1 0
12 13 1 0
13 4 1 0
13 14 2 0
9 15 1 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
20 22 1 0
22 23 2 0
23 17 1 0
15 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
28 30 1 0
30 31 2 0
31 25 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 454.31Molecular Weight (Monoisotopic): 453.0535AlogP: 6.00#Rotatable Bonds: 6Polar Surface Area: 70.75Molecular Species: ACIDHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.11CX Basic pKa: 0.97CX LogP: 6.14CX LogD: 2.67Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.36Np Likeness Score: -0.54
References 1. (2016) Therapeutic compounds,