The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4alpha-(furoic-2-acyl)-4-desoxy-podophyllotoxin ID: ALA3925676
PubChem CID: 134141950
Max Phase: Preclinical
Molecular Formula: C27H24O10
Molecular Weight: 508.48
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc([C@@H]2c3cc4c(cc3[C@H](OC(=O)c3ccco3)[C@H]3COC(=O)[C@H]23)OCO4)cc(OC)c1OC
Standard InChI: InChI=1S/C27H24O10/c1-30-20-7-13(8-21(31-2)25(20)32-3)22-14-9-18-19(36-12-35-18)10-15(14)24(16-11-34-27(29)23(16)22)37-26(28)17-5-4-6-33-17/h4-10,16,22-24H,11-12H2,1-3H3/t16-,22+,23-,24-/m0/s1
Standard InChI Key: NUHXIHVEMQHVAM-ZFIFVKQDSA-N
Molfile:
RDKit 2D
39 44 0 0 0 0 0 0 0 0999 V2000
5.6144 -11.9194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1432 -12.6692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5716 -12.7433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8341 -13.1161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1860 -11.8453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9198 -11.4641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7913 -13.9400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3454 -13.0326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4016 -13.0418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4870 -11.3939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6977 -15.5833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8600 -12.3951 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4144 -11.7036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0069 -15.1364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4316 -15.2021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7535 -11.7710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7107 -12.5949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0496 -14.3125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4738 -14.3864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9229 -12.8156 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9799 -11.4776 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4729 -12.1280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5529 -13.8321 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9626 -10.6402 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6549 -16.4072 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2739 -15.5010 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1224 -15.6489 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9213 -16.7842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5789 -15.0540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0796 -16.4727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5249 -13.5629 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5.6529 -11.0953 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
4.2739 -10.1935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3165 -9.3737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5427 -10.5665 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0036 -8.9252 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7908 -8.1325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9710 -8.0899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6773 -8.8564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 5 1 0
3 1 1 0
4 3 1 0
5 6 1 0
6 1 1 0
4 7 1 6
8 3 1 0
9 2 2 0
10 5 2 0
11 15 1 0
12 13 1 0
13 1 1 0
14 18 1 0
15 19 2 0
16 10 1 0
17 16 2 0
18 7 2 0
19 7 1 0
20 17 1 0
21 16 1 0
22 21 1 0
23 8 2 0
6 24 1 6
25 11 1 0
26 14 1 0
27 15 1 0
28 25 1 0
29 26 1 0
30 27 1 0
3 31 1 1
1 32 1 6
8 12 1 0
2 4 1 0
17 9 1 0
14 11 2 0
22 20 1 0
24 33 1 0
33 34 1 0
33 35 2 0
34 36 1 0
36 37 1 0
37 38 2 0
38 39 1 0
39 34 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 508.48Molecular Weight (Monoisotopic): 508.1369AlogP: 3.87#Rotatable Bonds: 6Polar Surface Area: 111.89Molecular Species: NEUTRALHBA: 10HBD: ┄#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.18CX LogD: 3.18Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.46Np Likeness Score: 1.07
References 1. Zhang L, Zhang Z, Chen F, Chen Y, Lin Y, Wang J.. (2016) Aromatic heterocyclic esters of podophyllotoxin exert anti-MDR activity in human leukemia K562/ADR cells via ROS/MAPK signaling pathways., 123 [PMID:27484511 ] [10.1016/j.ejmech.2016.07.050 ] 2. Xiao J, Gao M, Sun Z, Diao Q, Wang P, Gao F.. (2020) Recent advances of podophyllotoxin/epipodophyllotoxin hybrids in anticancer activity, mode of action, and structure-activity relationship: An update (2010-2020)., 208 [PMID:32992133 ] [10.1016/j.ejmech.2020.112830 ]