US9394303, 9

ID: ALA3925787

PubChem CID: 118414949

Max Phase: Preclinical

Molecular Formula: C25H19N3O4

Molecular Weight: 425.44

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1nn(Cc2cccc(Oc3ccccc3)c2)c2nc(-c3ccco3)cc(C(=O)O)c12

Standard InChI:  InChI=1S/C25H19N3O4/c1-16-23-20(25(29)30)14-21(22-11-6-12-31-22)26-24(23)28(27-16)15-17-7-5-10-19(13-17)32-18-8-3-2-4-9-18/h2-14H,15H2,1H3,(H,29,30)

Standard InChI Key:  RADPQZWXBWXXRU-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   -0.4916   -3.8582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3114   -2.9665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8032   -3.1233    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4133   -1.7530    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8794   -1.4442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8823   -2.5608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3506   -2.2538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3506   -3.3718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8824   -4.7969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4142   -5.1039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9428   -6.5288    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4733   -6.8339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0001   -8.2574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5308   -8.5594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5347   -7.4379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0078   -6.0145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4771   -5.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4142   -3.9859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6003   -1.4978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6387   -0.8963    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6024   -2.6978    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2121    3.8625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7463    5.2884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7537    5.2860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2149    3.8587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 10 18  2  0
 18  6  1  0
  4 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 24 26  1  0
 23 27  2  0
 27  2  1  0
 27 19  1  0
 21 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 28  2  0
M  END

Associated Targets(non-human)

Mcl1 Induced myeloid leukemia cell differentiation protein Mcl-1 homolog (108 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 425.44Molecular Weight (Monoisotopic): 425.1376AlogP: 5.54#Rotatable Bonds: 6
Polar Surface Area: 90.38Molecular Species: ACIDHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.51CX Basic pKa: 1.78CX LogP: 4.53CX LogD: 1.30
Aromatic Rings: 5Heavy Atoms: 32QED Weighted: 0.38Np Likeness Score: -1.59

References

1.  (2016)  Small molecule inhibitors of MCL-1 and uses thereof, 

Source

Source(1):