The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-(3-(4-hydroxy-3-isopropylphenoxy)-2,4-dimethylbenzyl)-1,3-thiazinane-2,4-dione ID: ALA392666
PubChem CID: 44441145
Max Phase: Preclinical
Molecular Formula: C22H25NO4S
Molecular Weight: 399.51
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(CC2CC(=O)NC(=O)S2)c(C)c1Oc1ccc(O)c(C(C)C)c1
Standard InChI: InChI=1S/C22H25NO4S/c1-12(2)18-10-16(7-8-19(18)24)27-21-13(3)5-6-15(14(21)4)9-17-11-20(25)23-22(26)28-17/h5-8,10,12,17,24H,9,11H2,1-4H3,(H,23,25,26)
Standard InChI Key: TWNAGPAVIUMOMK-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
-4.5473 -17.8208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5484 -18.6482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8336 -19.0610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1172 -18.6477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1200 -17.8172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8354 -17.4080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4071 -17.4020 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.6911 -17.8118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6913 -18.6344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9762 -19.0442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9838 -17.3937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2632 -19.0601 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.2618 -17.4085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2620 -16.5835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.9762 -17.8211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4052 -19.0480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2638 -17.7965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2626 -18.6291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4475 -17.3787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1651 -17.7859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1664 -18.6091 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.8798 -19.0162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5937 -18.6019 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5895 -17.7759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8715 -17.3643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8828 -19.8412 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3023 -17.3605 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.9936 -16.5687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 13 1 0
1 2 2 0
13 14 1 0
5 7 1 0
13 15 1 0
3 4 2 0
9 16 1 0
17 18 1 0
7 8 1 0
8 9 2 0
17 19 1 0
4 5 1 0
20 19 1 0
20 21 1 0
9 10 1 0
10 18 2 0
2 3 1 0
17 11 2 0
11 8 1 0
20 25 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
5 6 2 0
22 26 2 0
2 12 1 0
24 27 2 0
6 1 1 0
11 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 399.51Molecular Weight (Monoisotopic): 399.1504AlogP: 5.21#Rotatable Bonds: 5Polar Surface Area: 75.63Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.16CX Basic pKa: ┄CX LogP: 5.60CX LogD: 5.60Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.72Np Likeness Score: 0.10
References 1. Haning H, Mueller U, Schmidt G, Schmeck C, Voehringer V, Kretschmer A, Bischoff H.. (2007) Novel heterocyclic thyromimetics. Part 2., 17 (14): [PMID:17499989 ] [10.1016/j.bmcl.2007.04.085 ]