The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1-{3-[9-(4-Methoxyphenyl)-9H-fluoren-9-yloxy]propyl}-1H-imidazol-5-yl)acetic acid ID: ALA3926947
PubChem CID: 134141790
Max Phase: Preclinical
Molecular Formula: C28H26N2O4
Molecular Weight: 454.53
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(C2(OCCCn3cncc3CC(=O)O)c3ccccc3-c3ccccc32)cc1
Standard InChI: InChI=1S/C28H26N2O4/c1-33-22-13-11-20(12-14-22)28(34-16-6-15-30-19-29-18-21(30)17-27(31)32)25-9-4-2-7-23(25)24-8-3-5-10-26(24)28/h2-5,7-14,18-19H,6,15-17H2,1H3,(H,31,32)
Standard InChI Key: WXEWOUGXNHWRBB-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
11.7668 -3.3649 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.0193 -2.5853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3578 -2.1055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6970 -2.5864 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.9503 -3.3633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7963 -2.3320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2224 -4.7711 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.6352 -5.4810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0436 -4.7686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2307 -6.7398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9809 -5.9641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1858 -5.7939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6397 -6.3985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8942 -7.1760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6887 -7.3425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3022 -5.9631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0460 -6.7373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5879 -7.3442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3860 -7.1781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6394 -6.3997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0959 -5.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8641 -4.7687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2725 -4.0572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8597 -3.3463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0343 -3.3514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6297 -4.0635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2652 -2.6368 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.0824 -2.6332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4052 -4.7736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9945 -4.0671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1773 -4.0696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9654 -1.5325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7424 -1.2793 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.3576 -0.9863 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 1 1 0
2 6 1 0
8 7 1 0
9 8 1 0
10 17 1 0
16 8 1 0
8 11 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
9 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 9 1 0
24 27 1 0
27 28 1 0
7 29 1 0
29 30 1 0
30 31 1 0
31 1 1 0
6 32 1 0
32 33 1 0
32 34 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 454.53Molecular Weight (Monoisotopic): 454.1893AlogP: 4.90#Rotatable Bonds: 9Polar Surface Area: 73.58Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.61CX Basic pKa: 6.34CX LogP: 3.50CX LogD: 2.42Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.36Np Likeness Score: -0.19
References 1. Kerscher-Hack S, Renukappa-Gutke T, Höfner G, Wanner KT.. (2016) Synthesis and biological evaluation of a series of N-alkylated imidazole alkanoic acids as mGAT3 selective GABA uptake inhibitors., 124 [PMID:27654218 ] [10.1016/j.ejmech.2016.09.012 ]