US9162991, 28a

ID: ALA3927354

Cas Number: 140399-53-7

PubChem CID: 5828655

Max Phase: Preclinical

Molecular Formula: C18H11NO5

Molecular Weight: 321.29

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(/C=C/c1ccc([N+](=O)[O-])cc1)c1cc2ccccc2oc1=O

Standard InChI:  InChI=1S/C18H11NO5/c20-16(10-7-12-5-8-14(9-6-12)19(22)23)15-11-13-3-1-2-4-17(13)24-18(15)21/h1-11H/b10-7+

Standard InChI Key:  QFXNRCNXTVYFLC-JXMROGBWSA-N

Molfile:  

     RDKit          2D

 24 26  0  0  0  0  0  0  0  0999 V2000
   11.4299    0.9311    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.3875    1.5257    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.3817    2.7257    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0919    0.7681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0971   -0.7319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8007   -1.4864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4990   -0.7409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2003   -1.4932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8990   -0.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6024   -2.6977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2991    3.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -2.7000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4939    0.7591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7903    1.5136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 10 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 19 20  1  0
 20 21  1  0
 21 12  1  0
 21 22  2  0
  7 23  1  0
 23 24  2  0
 24  4  1  0
M  CHG  2   1  -1   2   1
M  END

Alternative Forms

Associated Targets(non-human)

TGM2 Protein-glutamine gamma-glutamyltransferase 2 (55 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 321.29Molecular Weight (Monoisotopic): 321.0637AlogP: 3.60#Rotatable Bonds: 4
Polar Surface Area: 90.42Molecular Species: HBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.00CX LogD: 4.00
Aromatic Rings: 3Heavy Atoms: 24QED Weighted: 0.24Np Likeness Score: -0.49

References

1.  (2015)  Cinnamoyl inhibitors of transglutaminase, 

Source

Source(1):