(1-{5-[9-(4-Methoxyphenyl)-9H-fluoren-9-yloxy]pentyl}-1H-imidazol-4-yl)acetic acid

ID: ALA3927994

PubChem CID: 134141710

Max Phase: Preclinical

Molecular Formula: C30H30N2O4

Molecular Weight: 482.58

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  COc1ccc(C2(OCCCCCn3cnc(CC(=O)O)c3)c3ccccc3-c3ccccc32)cc1

Standard InChI:  InChI=1S/C30H30N2O4/c1-35-24-15-13-22(14-16-24)30(27-11-5-3-9-25(27)26-10-4-6-12-28(26)30)36-18-8-2-7-17-32-20-23(31-21-32)19-29(33)34/h3-6,9-16,20-21H,2,7-8,17-19H2,1H3,(H,33,34)

Standard InChI Key:  KVYCIKIBCWFWQX-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   26.0794  -19.0022    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.4921  -19.7121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9006  -18.9998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0876  -20.9710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8378  -20.1953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0428  -20.0251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4967  -20.6297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7512  -21.4072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5457  -21.5736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1592  -20.1943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9030  -20.9684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4449  -21.5753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2430  -21.4093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4964  -20.6309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9529  -20.0273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7211  -18.9999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1295  -18.2883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7167  -17.5775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8913  -17.5826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4867  -18.2947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1222  -16.8680    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.9394  -16.8644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2622  -19.0047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8515  -18.2983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0343  -18.3007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6236  -17.5943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8064  -17.5967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3957  -16.8903    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.6195  -16.1045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9392  -15.6518    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.2984  -16.1589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5828  -16.9250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5114  -15.9387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3087  -15.1470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5220  -14.9270    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.8930  -14.5756    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4 11  1  0
 10  2  1  0
  2  5  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  3 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20  3  1  0
 18 21  1  0
 21 22  1  0
  1 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 28  1  0
 31 33  1  0
 33 34  1  0
 34 35  1  0
 34 36  2  0
M  END

Alternative Forms

1. Parent:

   

   ALA3927994

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 482.58

Molecular Weight (Monoisotopic): 482.2206

AlogP: 5.68

#Rotatable Bonds: 11

Polar Surface Area: 73.58

Molecular Species: ACID

HBA: 5

HBD: 1

#RO5 Violations: 1

HBA (Lipinski): 6

HBD (Lipinski): 1

#RO5 Violations (Lipinski): 1

CX Acidic pKa: 3.85

CX Basic pKa: 6.17

CX LogP: 4.51

CX LogD: 3.31

Aromatic Rings: 4

Heavy Atoms: 36

QED Weighted: 0.28

Np Likeness Score: -0.06

References

1. Kerscher-Hack S, Renukappa-Gutke T, Höfner G, Wanner KT..  (2016)  Synthesis and biological evaluation of a series of N-alkylated imidazole alkanoic acids as mGAT3 selective GABA uptake inhibitors.,  124  [PMID:27654218] [10.1016/j.ejmech.2016.09.012]

Source

Source(1):

• Scientific Literature