The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(1-{(2E)-4-[9-(4-Methoxyphenyl)-9H-fluoren-9-yloxy]but-2-en-1-yl}-1H-imidazol-2-yl)propanoic acid ID: ALA3928077
PubChem CID: 134141714
Max Phase: Preclinical
Molecular Formula: C30H28N2O4
Molecular Weight: 480.56
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(C2(OC/C=C/Cn3ccnc3CCC(=O)O)c3ccccc3-c3ccccc32)cc1
Standard InChI: InChI=1S/C30H28N2O4/c1-35-23-14-12-22(13-15-23)30(26-10-4-2-8-24(26)25-9-3-5-11-27(25)30)36-21-7-6-19-32-20-18-31-28(32)16-17-29(33)34/h2-15,18,20H,16-17,19,21H2,1H3,(H,33,34)/b7-6+
Standard InChI Key: PIEZLFLTLKUGEC-VOTSOKGWSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
25.6422 -1.9532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3019 -2.4356 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.9657 -1.9587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7151 -1.1782 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.8988 -1.1786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7417 -2.2147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3514 -1.6706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1275 -1.9266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7372 -1.3825 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.2939 -2.7267 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.4309 -6.1148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0223 -7.3736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7757 -6.5994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9834 -6.4272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4370 -7.0284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6884 -7.8044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4800 -7.9729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0939 -6.5969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8386 -7.3732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3828 -7.9804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1823 -7.8125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4347 -7.0320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8889 -6.4282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1341 -5.6997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8448 -6.1041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5475 -5.6896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5401 -4.8722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8240 -4.4710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1242 -4.8877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2432 -4.4559 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.9554 -4.8567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7185 -5.7038 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.7182 -4.8866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0103 -4.4783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0100 -3.6611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3022 -3.2528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 1 2 0
3 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
8 10 2 0
12 19 1 0
18 11 1 0
11 13 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
11 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
27 30 1 0
30 31 1 0
11 32 1 0
32 33 1 0
33 34 1 0
34 35 2 0
35 36 1 0
36 2 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 480.56Molecular Weight (Monoisotopic): 480.2049AlogP: 5.45#Rotatable Bonds: 10Polar Surface Area: 73.58Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.16CX Basic pKa: 6.36CX LogP: 3.94CX LogD: 2.87Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.31Np Likeness Score: -0.10
References 1. Kerscher-Hack S, Renukappa-Gutke T, Höfner G, Wanner KT.. (2016) Synthesis and biological evaluation of a series of N-alkylated imidazole alkanoic acids as mGAT3 selective GABA uptake inhibitors., 124 [PMID:27654218 ] [10.1016/j.ejmech.2016.09.012 ]